CAS 216018-58-5: 2,2':6',2''-terpyridine-4,4',4''-tricarboxylic acid
Description:2,2':6',2''-Terpyridine-4,4',4''-tricarboxylic acid is a complex organic compound characterized by its structure, which features a terpyridine backbone with three carboxylic acid functional groups. This compound is known for its ability to form coordination complexes with various metal ions, making it of interest in coordination chemistry and materials science. The presence of multiple carboxylic acid groups enhances its solubility in polar solvents and allows for potential applications in biological systems and as a ligand in metal-organic frameworks (MOFs). Additionally, the terpyridine moiety contributes to its photophysical properties, which can be exploited in sensors and electronic devices. The compound is typically synthesized through multi-step organic reactions, and its stability and reactivity can be influenced by the pH of the environment and the presence of metal ions. Overall, 2,2':6',2''-terpyridine-4,4',4''-tricarboxylic acid is a versatile compound with significant implications in various fields, including catalysis, drug delivery, and nanotechnology.
Formula:C18H11N3O6
InChI:InChI=1/C18H11N3O6/c22-16(23)9-1-3-19-12(5-9)14-7-11(18(26)27)8-15(21-14)13-6-10(17(24)25)2-4-20-13/h1-8H,(H,22,23)(H,24,25)(H,26,27)
- Synonyms:
- 2,2':6',2''-Terpyridin-4,4',4''-tricarbons?ure
- 216018-58-5
- Acide 2,2':6',2''-terpyridine-4,4',4''-tricarboxylique
- 2,2':6',2''-Terpyridine-4,4',4''-tricarboxylic acid
- [2,2':6',2''-terpyridine]-4,4',4''-tricarboxylic acid