CAS 216144-29-5: 3-(diethoxymethyl)furan
Description:3-(Diethoxymethyl)furan is an organic compound characterized by its furan ring, which is a five-membered aromatic heterocycle containing one oxygen atom. This compound features a diethoxymethyl substituent at the 3-position of the furan, which contributes to its chemical properties and reactivity. The presence of the diethoxymethyl group enhances its solubility in organic solvents and may influence its reactivity in various chemical reactions, such as nucleophilic substitutions or condensation reactions. 3-(Diethoxymethyl)furan may exhibit moderate volatility and is likely to be a liquid at room temperature. Its structure suggests potential applications in organic synthesis, particularly in the development of pharmaceuticals or agrochemicals, due to the furan moiety's ability to participate in diverse chemical transformations. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken. Overall, this compound represents a unique structure within the furan derivatives, with potential utility in various chemical applications.
Formula:C9H14O3
InChI:InChI=1/C9H14O3/c1-3-11-9(12-4-2)8-5-6-10-7-8/h5-7,9H,3-4H2,1-2H3
- Synonyms:
- Furan, 3-(Diethoxymethyl)-
| Brand | Product data | Purity | Price range | Estimated delivery |
|---|---|---|---|---|
 | 3-Furaldehyde diethyl acetal, 98% REF: 02-L15519CAS: 216144-29-5 | 98% | To inquire | Tue 25 Mar 25 |
 | 3-(Diethoxymethyl)furan REF: IN-DA003JI8CAS: 216144-29-5 | - - - | To inquire | Mon 31 Mar 25 |
 | 3-(Diethoxymethyl)furan REF: 10-F772154CAS: 216144-29-5 | 98% | - - - | Discontinued product |
3-Furaldehyde diethyl acetal, 98%
Ref: 02-L15519
| 5g | To inquire |
Ref: 10-F772154
| 1g | Discontinued | Request information | |
| 5g | Discontinued | Request information |
