CAS 21642-86-4: p-Hydroxyatropine

Description:p-Hydroxyatropine, with the CAS number 21642-86-4, is a chemical compound that belongs to the tropane alkaloid family, which is derived from the Atropa belladonna plant. It is characterized by its structural similarity to atropine, featuring a hydroxyl group at the para position of the aromatic ring. This modification influences its pharmacological properties, making it an important compound in medicinal chemistry. p-Hydroxyatropine exhibits anticholinergic activity, which means it can inhibit the action of acetylcholine at muscarinic receptors, leading to effects such as pupil dilation and reduced secretions. The compound is typically studied for its potential therapeutic applications, including its role in treating various conditions related to the autonomic nervous system. Additionally, its solubility and stability can vary depending on the pH of the environment, which is crucial for its formulation in pharmaceutical applications. Overall, p-Hydroxyatropine is a significant compound in the study of alkaloids and their effects on biological systems.

Formula:C₁₇H₂₃NO₄

InChI:InChI=1/C17H23NO4/c1-18-12-4-5-13(18)9-15(8-12)22-17(21)16(10-19)11-2-6-14(20)7-3-11/h2-3,6-7,12-13,15-16,19-20H,4-5,8-10H2,1H3/t12-,13+,15+,16?

InChI key:InChIKey=CTLUOTXKQOMPGW-ISMYBSGVNA-N

SMILES:O=C(OC1CC2N(C)C(CC2)C1)C(C3=CC=C(O)C=C3)CO

Synonyms:
Benzeneacetic acid, 4-hydroxy-α-(hydroxymethyl)-, (3-endo)-8-methyl-8-azabicyclo[3.2.1]oct-3-yl ester
Hydracrylic acid, 2-(p-hydroxyphenyl)-, (±)-, 1αH,5αH-tropan-3α-yl ester
Benzeneacetic acid, 4-hydroxy-α-(hydroxymethyl)-, 8-methyl-8-azabicyclo[3.2.1]oct-3-yl ester, endo-
1αH,5αH-Tropan-3α-ol, (±)-2-(p-hydroxyphenyl)hydracrylate (ester)
Benzeneacetic acid, 4-hydroxy-α-(hydroxymethyl)-, 8-methyl-8-azabicyclo[3.2.1]oct-3-yl ester, endo-(±)-