CAS 21691-44-1: Z-Nva-OH
Description:Z-Nva-OH, also known as Z-Norvaline-OH, is a chemical compound characterized by its structure as a derivative of norvaline, an amino acid. It features a Z (benzyloxycarbonyl) protecting group, which is commonly used in peptide synthesis to protect the amino group of the amino acid during chemical reactions. The presence of the hydroxyl (-OH) group indicates that it is a hydroxy derivative, which can influence its solubility and reactivity. Z-Nva-OH is typically utilized in the field of organic chemistry and biochemistry, particularly in the synthesis of peptides and other complex molecules. Its properties include being a white to off-white solid, soluble in polar solvents, and stable under standard laboratory conditions. The compound's applications may extend to research in drug development and the study of protein interactions, given its structural similarities to natural amino acids. As with any chemical substance, proper handling and safety protocols should be observed due to potential reactivity and biological effects.
Formula:C13H17NO4
InChI:InChI=1S/C13H17NO4/c1-2-6-11(12(15)16)14-13(17)18-9-10-7-4-3-5-8-10/h3-5,7-8,11H,2,6,9H2,1H3,(H,14,17)(H,15,16)/t11-/m0/s1
InChI key:InChIKey=NSJDRLWFFAWSFP-NSHDSACASA-N
SMILES:O=C(OCC=1C=CC=CC1)NC(C(=O)O)CCC
- Synonyms:
- (2S)-2-(Phenylmethoxycarbonylamino)pentanoic acid
- (Benzyloxycarbonyl)norvaline
- <span class="text-smallcaps">L</span>-(Carbobenzyloxy)norvaline
- <span class="text-smallcaps">L</span>-Norvaline, N-[(phenylmethoxy)carbonyl]-
- CBZ-L-norvaline
- Cbz-<span class="text-smallcaps">L</span>-norvaline
- Cbz-Norvaline
- N-(Benzyloxycarbonyl)-<span class="text-smallcaps">L</span>-norvaline
- N-(Benzyloxycarbonyl)norvaline
- N-(Carbobenzoxy)norvaline
- See more synonyms
- N-Carbobenzyloxy-<span class="text-smallcaps">L</span>-norvaline
- N-[(Phenylmethoxy)carbonyl]-<span class="text-smallcaps">L</span>-norvaline
- N-[(benzyloxy)carbonyl]-L-norvaline
- Norvaline, N-carboxy-, N-benzyl ester, <span class="text-smallcaps">L</span>-
- Z-<span class="text-smallcaps">L</span>-Norvaline
- Z-L-norvaline
