CAS 2173992-00-0: 1H-Pyrazole-4-methanamine, 1-methyl-α-(1-methylethyl)-, hydrochloride (1:2)
Description:1H-Pyrazole-4-methanamine, 1-methyl-α-(1-methylethyl)-, hydrochloride (1:2) is a chemical compound characterized by its pyrazole ring structure, which is a five-membered aromatic ring containing two nitrogen atoms. This compound features a methanamine group and a branched alkyl substituent, specifically a 1-methyl-α-(1-methylethyl) group, contributing to its unique properties. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in various applications, particularly in pharmaceuticals. The presence of the hydrochloride indicates that it can form stable ionic interactions, which may influence its biological activity and pharmacokinetics. The compound's molecular structure suggests potential applications in medicinal chemistry, particularly in the development of drugs targeting specific biological pathways. Additionally, its CAS number, 2173992-00-0, allows for precise identification and retrieval of information regarding its synthesis, properties, and safety data in chemical databases.
Formula:C8H15N3·2ClH
InChI:InChI=1S/C8H15N3.2ClH/c1-6(2)8(9)7-4-10-11(3)5-7;;/h4-6,8H,9H2,1-3H3;2*1H
InChI key:InChIKey=WYWFKJPONLCTPG-UHFFFAOYSA-N
SMILES:Cl.N1=CC(=CN1C)C(N)C(C)C
- Synonyms:
- 1H-Pyrazole-4-methanamine, 1-methyl-α-(1-methylethyl)-, hydrochloride (1:2)
| Brand | Product data | Purity | Price range | Estimated delivery |
|---|---|---|---|---|
 | 2-methyl-1-(1-methyl-1H-pyrazol-4-yl)propan-1-amine dihydrochloride REF: IN-DA00IKZGCAS: 2173992-00-0 | 97% | 142.00 €~224.00 € | Wed 26 Mar 25 |
 | 2-Methyl-1-(1-methylpyrazol-4-yl)propan-1-amine dihydrochloride REF: 10-F624996CAS: 2173992-00-0 | 98% | - - - | Discontinued product |
 | 2-Methyl-1-(1-methyl-1H-pyrazol-4-yl)propan-1-amine dihydrochloride REF: 3D-YLD99200CAS: 2173992-00-0 | Min. 95% | - - - | Discontinued product |
2-methyl-1-(1-methyl-1H-pyrazol-4-yl)propan-1-amine dihydrochloride
Ref: IN-DA00IKZG
| 100mg | 142.00 € | ||
| 250mg | 189.00 € | ||
| 500mg | 224.00 € |
2-Methyl-1-(1-methylpyrazol-4-yl)propan-1-amine dihydrochloride
Ref: 10-F624996
| 100mg | Discontinued | Request information | |
| 250mg | Discontinued | Request information | |
| 500mg | Discontinued | Request information |
2-Methyl-1-(1-methyl-1H-pyrazol-4-yl)propan-1-amine dihydrochloride
Ref: 3D-YLD99200
| 1g | Discontinued | Request information |
