CAS 21816-08-0: 3-Bromo-1-adamantanecarboxylic acid

Description:3-Bromo-1-adamantanecarboxylic acid is a chemical compound characterized by its adamantane structure, which is a polycyclic hydrocarbon known for its unique cage-like configuration. This compound features a bromine atom attached to the third carbon of the adamantane framework, along with a carboxylic acid functional group (-COOH) at the first position. The presence of the bromine substituent can influence the compound's reactivity and physical properties, such as solubility and boiling point. Typically, compounds like this exhibit moderate to high lipophilicity due to the hydrophobic nature of the adamantane core, which can affect their biological activity and interactions. Additionally, the carboxylic acid group contributes to the compound's acidity and potential for forming hydrogen bonds, which can enhance solubility in polar solvents. Overall, 3-Bromo-1-adamantanecarboxylic acid is of interest in various fields, including medicinal chemistry and materials science, due to its unique structural features and potential applications.

Formula:C₁₁H₁₅BrO₂

InChI:InChI=1S/C11H15BrO2/c12-11-4-7-1-8(5-11)3-10(2-7,6-11)9(13)14/h7-8H,1-6H2,(H,13,14)

InChI key:InChIKey=DJUDQBVINJIMFO-UHFFFAOYSA-N

SMILES:O=C(O)C12CC3CC(CC(Br)(C3)C1)C2

Synonyms:
(5R,7R)-3-bromotricyclo[3.3.1.1~3,7~]decane-1-carboxylate
1-Adamantanecarboxylic acid, 3-bromo-
1-Bromo-3-carboxyadamantane
1-Bromoadamantane-3-carboxylic acid
3-Bromo-1-adamantanecarboxylic acid
3-Bromo-1-carboxyadamantane
3-Bromoadamantan-1-carboxylic acid
3-Bromoadamantane-1-carboxylic acid
3-Bromotricyclo[3.3.1.1<sup>3,7</sup>]decane-1-carboxylic acid
3-Bromotricyclo[3.3.1.1~3,7~]Decane-1-Carboxylic Acid
See more synonyms
Tricyclo[3.3.1.1<sup>3,7</sup>]decane-1-carboxylic acid, 3-bromo-
3-Bromotricyclo[3.3.1.13,7]decane-1-carboxylic acid
Tricyclo[3.3.1.13,7]decane-1-carboxylic acid, 3-bromo-

Found 6 products.

Product data	Purity	Price range	Estimated delivery
3-Bromoadamantane-1-carboxylic acid, 97% REF: 02-H60580CAS: 21816-08-0	97%	To inquire	Fri 21 Mar 25
3-Bromoadamantane-1-carboxylic acid REF: IN-DA003J3WCAS: 21816-08-0	98%	25.00 €~155.00 €	Thu 27 Mar 25
3-Bromoadamantane-1-carboxylic acid REF: 54-OR1538CAS: 21816-08-0	97%	32.00 €~36.00 €	Fri 28 Mar 25
3-Bromo-adamantane-1-carboxylic acid REF: 10-F343523CAS: 21816-08-0	95.0%	To inquire	Tue 08 Apr 25
3-Bromoadamantane-1-carboxylic acid REF: 3D-FB10494CAS: 21816-08-0	Min. 95%	145.00 €~674.00 €	Mon 07 Apr 25
3-Bromo-1-adamantane Carboxylic Acid REF: TR-B678885CAS: 21816-08-0	- - -	92.00 €~183.00 €	Wed 07 May 25