CAS 219635-91-3: 1-(6-Bromo-2-pyridinyl)piperazine

Description:1-(6-Bromo-2-pyridinyl)piperazine is a chemical compound characterized by its piperazine core, which is a six-membered ring containing two nitrogen atoms. The presence of a 6-bromo-2-pyridinyl group indicates that a bromine atom is substituted at the sixth position of a pyridine ring, which is a heterocyclic aromatic compound containing one nitrogen atom. This compound is often studied for its potential pharmacological properties, particularly in the field of medicinal chemistry, where piperazine derivatives are known to exhibit various biological activities, including antipsychotic and antidepressant effects. The bromine substituent can influence the compound's lipophilicity and biological interactions. Additionally, the molecular structure allows for potential interactions with neurotransmitter receptors, making it a candidate for research in neuropharmacology. Its solubility, stability, and reactivity can vary based on the specific conditions and solvents used, which are important considerations in both laboratory and therapeutic applications.

Formula:C₉H₁₂BrN₃

InChI:InChI=1S/C9H12BrN3/c10-8-2-1-3-9(12-8)13-6-4-11-5-7-13/h1-3,11H,4-7H2

InChI key:InChIKey=WBRRYSNZMKKYLZ-UHFFFAOYSA-N

SMILES:BrC=1N=C(C=CC1)N2CCNCC2

Synonyms:
1-(6-Bromo-2-pyridinyl)piperazine
1-(6-Bromopyridin-2-yl)piperazine
Piperazine, 1-(6-Bromo-2-Pyridinyl)-

Found 5 products.

Product data	Purity	Price range	Estimated delivery
1-(6-Bromopyridin-2-yl)piperazine REF: IN-DA007OQLCAS: 219635-91-3	97%	192.00 €~533.00 €	Thu 27 Mar 25
1-(6-Bromopyridin-2-yl)piperazine REF: 10-F764202CAS: 219635-91-3	98%	141.00 €~512.00 €	Tue 01 Apr 25
1-(6-Bromo-2-pyridyl)piperazine REF: 54-OR47868CAS: 219635-91-3	- - -	565.00 €	Thu 03 Apr 25
1-(6-bromo-2-pyridinyl)piperazine hydrochloride REF: 10-F359212CAS: 219635-91-3	95.0%	- - -	Discontinued product
1-(6-Bromopyridin-2-yl)piperazine REF: 3D-UIA63591CAS: 219635-91-3	Min. 95%	- - -	Discontinued product