CAS 219786-51-3: 2-(3-Bromopropoxy)-1-methoxy-4-nitrobenzene

Description:2-(3-Bromopropoxy)-1-methoxy-4-nitrobenzene, identified by its CAS number 219786-51-3, is an organic compound characterized by its complex structure, which includes a nitro group, a methoxy group, and a bromopropoxy substituent on a benzene ring. This compound typically exhibits properties associated with aromatic compounds, such as stability and distinct reactivity due to the presence of electron-withdrawing and electron-donating groups. The nitro group is known for its strong electron-withdrawing effect, which can influence the compound's reactivity in electrophilic substitution reactions. The bromopropoxy group introduces a hydrophobic character, potentially affecting solubility in various solvents. Additionally, the methoxy group can enhance the compound's electron density, influencing its chemical behavior. Overall, this compound may be of interest in synthetic organic chemistry and materials science, particularly in the development of pharmaceuticals or agrochemicals, due to its unique functional groups and potential for further chemical modification.

Formula:C₁₀H₁₂BrNO₄

InChI:InChI=1S/C10H12BrNO4/c1-15-9-4-3-8(12(13)14)7-10(9)16-6-2-5-11/h3-4,7H,2,5-6H2,1H3

InChI key:InChIKey=QWXOIJKDQIWILW-UHFFFAOYSA-N

SMILES:O=N(=O)C1=CC=C(OC)C(OCCCBr)=C1