CAS 219841-92-6: 5-cyano-2-iodobenzoic acid

Description: 5-Cyano-2-iodobenzoic acid is an organic compound characterized by the presence of both a cyano group (-CN) and an iodine atom attached to a benzoic acid structure. The molecular formula typically includes carbon, hydrogen, nitrogen, oxygen, and iodine, reflecting its complex structure. This compound is known for its potential applications in medicinal chemistry and as an intermediate in the synthesis of various pharmaceuticals. The cyano group contributes to its reactivity, allowing for further chemical modifications, while the iodine atom can enhance its biological activity or facilitate radiolabeling in imaging studies. The presence of the carboxylic acid functional group (-COOH) imparts acidic properties, making it soluble in polar solvents. Additionally, the compound may exhibit specific spectral characteristics in techniques such as NMR and IR spectroscopy, which can be used for its identification and characterization. Overall, 5-cyano-2-iodobenzoic acid is a versatile compound with significant implications in chemical research and development.

Formula: C₈H₄INO₂

InChI: InChI=1/C8H4INO2/c9-7-2-1-5(4-10)3-6(7)8(11)12/h1-3H,(H,11,12)

Synonyms:

• Benzoic acid, 5-cyano-2-iodo-
• 5-CYANO-2-IODOBENZOIC ACID

5-CYANO-2-IODOBENZOIC ACID

CAS: 219841-92-6

• Formula: C₈H₄INO₂
• Purity: 95%
• Color and Shape: Solid
• Molecular weight: 273.0273

5-Cyano-2-iodobenzoic acid

CAS: 219841-92-6

• Molecular weight: 273.03g/mol

5-Cyano-2-iodobenzoic acid

CAS: 219841-92-6

• Purity: 95.0%
• Molecular weight: 273.02899169921875

5-Cyano-2-iodobenzoic acid

CAS: 219841-92-6

Versatile small molecule scaffold

• Formula: C₈H₄INO₂
• Purity: Min. 95%
• Molecular weight: 273.03 g/mol