CAS 220352-38-5: (1R,2S)-2-(3,4-Difluorophenyl)cyclopropanamine

Description:(1R,2S)-2-(3,4-Difluorophenyl)cyclopropanamine is a chemical compound characterized by its cyclopropane structure, which features a three-membered carbon ring. The compound has a specific stereochemistry, indicated by the (1R,2S) configuration, which refers to the spatial arrangement of its atoms. The presence of a 3,4-difluorophenyl group suggests that the compound contains two fluorine atoms substituted on a phenyl ring, influencing its electronic properties and potentially its reactivity. Cyclopropanamines are known for their unique strain and reactivity due to the angle strain in the cyclopropane ring, which can lead to interesting chemical behavior. This compound may exhibit biological activity, making it of interest in medicinal chemistry, particularly in the development of pharmaceuticals. Its specific interactions and properties would depend on the functional groups present and their spatial arrangement, which can significantly affect the compound's overall behavior in chemical reactions and biological systems.

Formula:C₉H₉F₂N

InChI:InChI=1S/C9H9F2N/c10-7-2-1-5(3-8(7)11)6-4-9(6)12/h1-3,6,9H,4,12H2/t6-,9+/m0/s1

InChI key:InChIKey=QVUBIQNXHRPJKK-IMTBSYHQSA-N

SMILES:FC1=CC=C(C=C1F)C2CC2N

Synonyms:
(1R,2R)-2-(3,4-difluorophenyl)cyclopropanamine
(1R,2S)-2-(3,4-Difluorophenyl)cyclopropan-1-amine
(1R,2S)-2-(3,4-Difluorophenyl)cyclopropylamine
cyclopropanamine, 2-(3,4-difluorophenyl)-, (1R,2S)-
(1R,2S)-2-(3,4-Difluorophenyl)-cyclopropanamine
(1R,2S)-2-(3,4-Difluorophenyl)cyclopropanamine

Found 3 products.

Product data	Purity	Price range	Estimated delivery
Cyclopropanamine, 2-(3,4-difluorophenyl)-, (1R,2S)- REF: IN-DA00I4B3CAS: 220352-38-5	- - -	To inquire	Thu 27 Mar 25
(1R,2S)-2-(3,4-Difluorophenyl)cyclopropanamine REF: 54-PC906570CAS: 220352-38-5	95%	To inquire	Fri 28 Mar 25
(1R,2S)-2-(3,4-Difluorophenyl)cyclopropanamine REF: 3D-FD16311CAS: 220352-38-5	Min. 95%	136.00 €~552.00 €	Thu 08 May 25