CAS 22041-21-0: Methyl 1-pyrrolidinepropanoate
Description:Methyl 1-pyrrolidinepropanoate, with the CAS number 22041-21-0, is an organic compound characterized by its ester functional group, which is derived from the reaction of methyl alcohol and 1-pyrrolidinepropanoic acid. This compound features a pyrrolidine ring, contributing to its cyclic structure and potential for various chemical interactions. It is typically a colorless to pale yellow liquid with a distinctive odor, indicative of its ester nature. Methyl 1-pyrrolidinepropanoate is soluble in organic solvents, which makes it useful in various applications, including as a solvent or intermediate in organic synthesis. Its chemical properties may include moderate volatility and reactivity, particularly in the presence of nucleophiles or under acidic or basic conditions. Safety data should be consulted for handling, as it may pose health risks if inhaled or ingested. Overall, this compound is of interest in both industrial and research settings due to its unique structural features and potential applications in the synthesis of more complex molecules.
Formula:C8H15NO2
InChI:InChI=1S/C8H15NO2/c1-11-8(10)4-7-9-5-2-3-6-9/h2-7H2,1H3
InChI key:InChIKey=JHYKOXJKJHTKTE-UHFFFAOYSA-N
SMILES:O=C(OC)CCN1CCCC1
- Synonyms:
- 1-Pyrrolidinepropanoic acid, methyl ester
- 1-Pyrrolidinepropanoic acid, methyl ester (9CI)
- 1-Pyrrolidinepropionic acid, methyl ester
- 3-Pyrrolidin-1-yl-propionic acid methyl ester
- Methyl 1-pyrrolidinepropanoate
- Methyl 1-pyrrolidinepropionate
- Methyl 3-(1-pyrrolidinyl)propionate
- Methyl 3-pyrrolidinopropanoate
- Methyl 3-pyrrolidinopropionate
| Brand | Product data | Purity | Price range | Estimated delivery |
|---|---|---|---|---|
 | METHYL 3-(PYRROLIDIN-1-YL)PROPANOATE REF: IN-DA00C207CAS: 22041-21-0 | - - - | To inquire | Thu 27 Mar 25 |
 | Methyl 3-(Pyrrolidin-1-yl)propanoate REF: 10-F043218CAS: 22041-21-0 | 95.0% | - - - | Discontinued product |
 | Methyl 3-pyrrolidin-1-ylpropanoate REF: 3D-FM126673CAS: 22041-21-0 | Min. 95% | - - - | Discontinued product |
Ref: IN-DA00C207
| Undefined size | To inquire |
Ref: 10-F043218
| 1g | Discontinued | Request information | |
| 5g | Discontinued | Request information | |
| 10g | Discontinued | Request information | |
| 2.5g | Discontinued | Request information | |
| 100mg | Discontinued | Request information | |
| 250mg | Discontinued | Request information | |
| 500mg | Discontinued | Request information |
Methyl 3-pyrrolidin-1-ylpropanoate
Ref: 3D-FM126673
| 1g | Discontinued | Request information | |
| 2g | Discontinued | Request information | |
| 5g | Discontinued | Request information | |
| 250mg | Discontinued | Request information | |
| 500mg | Discontinued | Request information |
