CAS 220497-47-2: (S)-N-FMOC-2-Bromophenylalanine
Description:(S)-N-FMOC-2-Bromophenylalanine is a derivative of the amino acid phenylalanine, characterized by the presence of a 2-bromophenyl group and a 9-fluorenylmethoxycarbonyl (FMOC) protecting group. This compound is typically used in peptide synthesis, particularly in solid-phase peptide synthesis (SPPS), where the FMOC group serves as a protective moiety for the amino group, allowing for selective deprotection and coupling reactions. The bromine atom in the 2-position of the phenyl ring can facilitate further chemical modifications, making it a versatile building block in medicinal chemistry and drug development. The stereochemistry of the molecule is specified as (S), indicating that it has a specific spatial arrangement that can influence its biological activity and interactions. Overall, (S)-N-FMOC-2-Bromophenylalanine is valued for its utility in synthesizing peptides with specific structural and functional properties, contributing to advancements in biochemistry and pharmaceutical research.
Formula:C24H19BrNO4
InChI:InChI=1/C24H20BrNO4/c25-21-12-6-1-7-15(21)13-22(23(27)28)26-24(29)30-14-20-18-10-4-2-8-16(18)17-9-3-5-11-19(17)20/h1-12,20,22H,13-14H2,(H,26,29)(H,27,28)/p-1/t22-/m0/s1
- Synonyms:
- Fmoc-L-2-Bromophenylalanine
- Fmoc-2-Bromo-L-phenylalanine
- Fmoc-Phe(2-Br)-OH
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | Fmoc-Phe(2-Br)-OH REF: IN-DA003QNICAS: 220497-47-2 | 97% | 27.00 €~273.00 € | Thu 27 Mar 25 |
![]() | 2-Bromo-L-phenylalanine, N-FMOC protected REF: 54-OR14554CAS: 220497-47-2 | 98% | 62.00 €~752.00 € | Fri 28 Mar 25 |
![]() | Fmoc-Phe(2-Br)-OH REF: 7W-GM9584CAS: 220497-47-2 | - - - | To inquire | Fri 28 Mar 25 |
![]() | Fmoc-Phe(2-Br)-OH REF: 10-F544860CAS: 220497-47-2 | 95% | - - - | Discontinued product |
![]() | Fmoc-2-bromo-L-phenylalanine REF: 3D-FF49200CAS: 220497-47-2 | Min. 95% | - - - | Discontinued product |

Fmoc-Phe(2-Br)-OH
Ref: IN-DA003QNI
1g | 41.00 € | ||
5g | 97.00 € | ||
25g | 273.00 € | ||
250mg | 27.00 € |

Ref: 54-OR14554
1g | 62.00 € | ||
5g | 196.00 € | ||
25g | 752.00 € |

Ref: 10-F544860
1g | Discontinued | Request information | |
5g | Discontinued | Request information | |
25g | Discontinued | Request information |

Fmoc-2-bromo-L-phenylalanine
Ref: 3D-FF49200
1g | Discontinued | Request information | |
2g | Discontinued | Request information | |
5g | Discontinued | Request information | |
10g | Discontinued | Request information | |
25g | Discontinued | Request information |