CAS 220497-51-8: 5-Bromo-N-[(9H-fluoren-9-ylmethoxy)carbonyl]-2-methoxy-<span class="text-smallcaps">L</span>-phenylalanine

Description:5-Bromo-N-[(9H-fluoren-9-ylmethoxy)carbonyl]-2-methoxy-L-phenylalanine, with CAS number 220497-51-8, is a synthetic amino acid derivative commonly used in peptide synthesis and research applications. This compound features a bromine atom, which enhances its reactivity and can facilitate various chemical transformations. The presence of the fluorenylmethoxycarbonyl (Fmoc) protecting group allows for selective deprotection during peptide synthesis, making it valuable in the field of organic chemistry and biochemistry. The methoxy group contributes to the compound's solubility and stability, while the L-phenylalanine backbone provides chirality, which is crucial for biological activity. This compound is typically characterized by its solid state, and it may exhibit specific melting and boiling points, as well as distinct spectral properties in techniques such as NMR and mass spectrometry. Overall, its unique structure and functional groups make it a versatile reagent in the synthesis of complex peptides and other bioactive molecules.

Formula:C₂₅H₂₂BrNO₅

InChI:InChI=1S/C25H22BrNO5/c1-31-23-11-10-16(26)12-15(23)13-22(24(28)29)27-25(30)32-14-21-19-8-4-2-6-17(19)18-7-3-5-9-20(18)21/h2-12,21-22H,13-14H2,1H3,(H,27,30)(H,28,29)/t22-/m0/s1

InChI key:InChIKey=QIIKXJDEJNMZBK-QFIPXVFZSA-N

SMILES:O=C(OCC1C=2C=CC=CC2C=3C=CC=CC31)NC(C(=O)O)CC4=CC(Br)=CC=C4OC

Found 3 products.

Product data	Purity	Price range	Estimated delivery
Fmoc-5-bromo-2-methoxy-L-phenylalanine REF: IN-DA01DO6GCAS: 220497-51-8	97%	226.00 €~469.00 €	Thu 27 Mar 25
(S)-2-((((9H-fluoren-9-yl)methoxy)carbonyl)amino)-3-(5-bromo-2-methoxyphenyl)propanoic acid REF: 10-F731157CAS: 220497-51-8	97%	- - -	Discontinued product
Fmoc-5-bromo-2-methoxy-L-phenylalanine REF: 3D-VIA49751CAS: 220497-51-8	Min. 95%	- - -	Discontinued product