CAS 22091-37-8: 4-(Chloromethyl)-2-(3-chlorophenyl)oxazole
Description:4-(Chloromethyl)-2-(3-chlorophenyl)oxazole, with the CAS number 22091-37-8, is a chemical compound characterized by its oxazole ring structure, which is a five-membered heterocyclic compound containing both nitrogen and oxygen. This substance features a chloromethyl group and a 3-chlorophenyl substituent, contributing to its unique chemical properties. The presence of chlorine atoms enhances its reactivity and may influence its biological activity, making it of interest in various fields, including medicinal chemistry and materials science. The compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. Its synthesis often involves reactions that introduce the chloromethyl and phenyl groups onto the oxazole framework. Due to its structural characteristics, it may possess potential applications in pharmaceuticals or as an intermediate in organic synthesis. However, specific safety and handling guidelines should be followed, as halogenated compounds can pose environmental and health risks. Always refer to material safety data sheets (MSDS) for detailed safety information.
Formula:C10H7Cl2NO
InChI:InChI=1S/C10H7Cl2NO/c11-5-9-6-14-10(13-9)7-2-1-3-8(12)4-7/h1-4,6H,5H2
InChI key:InChIKey=PJLBVWOUVSFJQU-UHFFFAOYSA-N
SMILES:ClC1=CC=CC(=C1)C2=NC(=CO2)CCl
- Synonyms:
- 4-(Chloromethyl)-2-(3-chlorophenyl)oxazole
- Oxazole, 4-(chloromethyl)-2-(3-chlorophenyl)-
- Oxazole, 4-(chloromethyl)-2-(m-chlorophenyl)-
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | 4-(Chloromethyl)-2-(3-chlorophenyl)-1,3-oxazole REF: 10-F660249CAS: 22091-37-8 | 98% | - - - | Discontinued product |
![]() | 4-(Chloromethyl)-2-(3-chlorophenyl)-1,3-oxazole REF: 3D-XAA09137CAS: 22091-37-8 | Min. 95% | - - - | Discontinued product |

4-(Chloromethyl)-2-(3-chlorophenyl)-1,3-oxazole
Ref: 10-F660249
1g | Discontinued | Request information | |
2.5g | Discontinued | Request information | |
50mg | Discontinued | Request information | |
100mg | Discontinued | Request information | |
250mg | Discontinued | Request information | |
500mg | Discontinued | Request information |

4-(Chloromethyl)-2-(3-chlorophenyl)-1,3-oxazole
Ref: 3D-XAA09137
50mg | Discontinued | Request information | |
500mg | Discontinued | Request information |