CAS 221323-58-6: 3-Formyl-1-methyl-1H-pyrazole-5-carboxylic acid

Description: 3-Formyl-1-methyl-1H-pyrazole-5-carboxylic acid is an organic compound characterized by its pyrazole ring structure, which is a five-membered heterocyclic compound containing two nitrogen atoms. This substance features a formyl group (-CHO) at the 3-position and a carboxylic acid group (-COOH) at the 5-position, contributing to its reactivity and potential applications in organic synthesis. The presence of the methyl group at the 1-position enhances its stability and solubility in various solvents. This compound is of interest in medicinal chemistry and agricultural chemistry due to its potential biological activities, including antimicrobial and anti-inflammatory properties. Its unique structure allows for various chemical modifications, making it a valuable intermediate in the synthesis of more complex molecules. Additionally, the compound's properties, such as melting point, solubility, and reactivity, can vary based on environmental conditions and the presence of other functional groups in a reaction mixture. Overall, 3-Formyl-1-methyl-1H-pyrazole-5-carboxylic acid is a versatile compound with significant implications in research and development.

Formula: C₆H₆N₂O₃

InChI: InChI=1S/C6H6N2O3/c1-8-5(6(10)11)2-4(3-9)7-8/h2-3H,1H3,(H,10,11)

InChI key: InChIKey=UUKTVALKHIMMHN-UHFFFAOYSA-N

SMILES: O=CC1=NN(C(=C1)C(=O)O)C

Synonyms:

• 5-Formyl-2-methyl-2H-pyrazole-3-carboxylic acid
• 3-Formyl-1-methyl-1H-pyrazole-5-carboxylic acid
• 1H-Pyrazole-5-carboxylic acid, 3-formyl-1-methyl-

3-Formyl-1-methyl-1H-pyrazole-5-carboxylic acid

CAS: 221323-58-6

• Purity: 97%
• Molecular weight: 154.125

3-Formyl-1-methyl-1H-pyrazole-5-carboxylic acid

CAS: 221323-58-6

Please enquire for more information about 3-Formyl-1-methyl-1H-pyrazole-5-carboxylic acid including the price, delivery time and more …

• Formula: C₆H₆N₂O₃
• Purity: Min. 95%
• Molecular weight: 154.12 g/mol