CAS 2215-63-6: 1-Benzyl-1H-indazol-3-ol
Description:1-Benzyl-1H-indazol-3-ol, with the CAS number 2215-63-6, is an organic compound characterized by its indazole core, which is a five-membered heterocyclic structure containing two nitrogen atoms. This compound features a benzyl group attached to the nitrogen of the indazole, along with a hydroxyl (-OH) group at the 3-position of the indazole ring. The presence of the hydroxyl group contributes to its potential as a phenolic compound, which can exhibit various biological activities, including antioxidant properties. The compound is typically a solid at room temperature and may be soluble in organic solvents, depending on the specific conditions. Its structure allows for potential interactions in biological systems, making it of interest in medicinal chemistry and drug development. Additionally, the compound's reactivity can be influenced by the functional groups present, which may participate in various chemical reactions, including hydrogen bonding and electrophilic substitutions. Overall, 1-Benzyl-1H-indazol-3-ol is a compound of interest for its structural features and potential applications in pharmaceuticals.
Formula:C14H12N2O
InChI:InChI=1S/C14H12N2O/c17-14-12-8-4-5-9-13(12)16(15-14)10-11-6-2-1-3-7-11/h1-9H,10H2,(H,15,17)
InChI key:InChIKey=SXPJFDSMKWLOAB-UHFFFAOYSA-N
SMILES:O=C1NN(C=2C=CC=CC12)CC=3C=CC=CC3
- Synonyms:
- 1,2-Dihydro-1-(phenylmethyl)-3H-indazol-3-one
- 1-Benzyl-1,2-dihydro-3H-indazol-3-one
- 1-Benzyl-1H-indazol-3(2H)-one
- 1-Benzyl-1H-indazol-3-ol
- 1-Benzyl-1H-indazol-3-one
- 1-Benzyl-1H-indazolone
- 1-Benzyl-2,3-dihydro-1H-indazol-3-one
- 1-Benzyl-2H-indazol-3-one
- 1-Benzyl-3-hydroxyindazole
- 1-Benzyl-3-indazolinone
- See more synonyms
- 1-Benzyl-3-indazolone
- 1-Benzylindazolone Sodium Salt
- 1H-Indazol-3-ol, 1-benzyl-
- 1H-indazol-3-ol, 1-(phenylmethyl)-, sodium salt (1:1)
- 3-Hydroxy-1-benzyl-1H-indazole
- 3-Indazolinone, 1-benzyl-
- 3H-Indazol-3-one, 1,2-dihydro-1-(phenylmethyl)-
- NSC 247064
- Sodium 1-benzyl-1H-indazol-3-olate
- 1-Benzyl-3-hydroxy-1H-indazole
