CAS 2216-30-0: 2,5-Dimethyl heptane
Description:2,5-Dimethylheptane is an organic compound classified as an alkane, specifically a branched-chain hydrocarbon. Its molecular formula is C9H20, indicating it consists of nine carbon atoms and twenty hydrogen atoms. This compound features two methyl groups attached to the heptane backbone at the 2nd and 5th carbon positions, which contributes to its branched structure. 2,5-Dimethylheptane is a colorless liquid at room temperature and is typically insoluble in water due to its nonpolar nature, but it is soluble in organic solvents. It has a relatively high boiling point compared to straight-chain alkanes of similar molecular weight, reflecting the influence of branching on boiling point elevation. This compound is primarily used in research and industrial applications, including as a reference standard in gas chromatography. Its physical and chemical properties, such as density and viscosity, are influenced by its molecular structure, making it an interesting subject for studies related to hydrocarbon behavior and fuel properties.
Formula:C9H20
InChI:InChI=1/C9H20/c1-5-9(4)7-6-8(2)3/h8-9H,5-7H2,1-4H3
- Synonyms:
- 2,5-Dimethylheptane
| Brand | Product data | Purity | Price range | Estimated delivery |
|---|---|---|---|---|
 | 2,5-Dimethylheptane REF: 3B-D1205CAS: 2216-30-0 | >98.0%(GC) | 142.00 € | Thu 20 Mar 25 |
 | 2,5-Dimethylheptane REF: 54-OR52417CAS: 2216-30-0 | - - - | To inquire | Fri 28 Mar 25 |
 | PIANO Isoparaffins Mixture 90 REF: 04-GA0900090CAS: | - - - | 299.00 € | Tue 01 Apr 25 |
 | 2,5-Dimethylheptane REF: 3D-CAA21630CAS: 2216-30-0 | Min. 95% | - - - | Discontinued product |
2,5-Dimethylheptane
Ref: 3B-D1205
| 1ml | 142.00 € |
Ref: 54-OR52417
| Undefined size | To inquire |
PIANO Isoparaffins Mixture 90
Controlled ProductRef: 04-GA0900090
| 1ml | 299.00 € |
2,5-Dimethylheptane
Ref: 3D-CAA21630
| 1ml | Discontinued | Request information | |
| 5ml | Discontinued | Request information | |
| 10ml | Discontinued | Request information | |
| 25ml | Discontinued | Request information | |
| 50ml | Discontinued | Request information |
