CAS 2217-40-5: 1,2,3,4-Tetrahydro-1-naphthylamine
Description:1,2,3,4-Tetrahydro-1-naphthylamine is an organic compound characterized by its bicyclic structure, which consists of a naphthalene ring fused with a saturated amine. This compound is typically a colorless to pale yellow liquid or solid, depending on its purity and temperature. It has a relatively low melting point and boiling point, indicating it is a volatile substance. The presence of the amine functional group imparts basic properties, allowing it to participate in various chemical reactions, such as nucleophilic substitutions. It is often used as an intermediate in the synthesis of dyes, pharmaceuticals, and other organic compounds. Additionally, 1,2,3,4-Tetrahydro-1-naphthylamine may exhibit moderate toxicity, necessitating careful handling and appropriate safety measures in laboratory and industrial settings. Its chemical stability and reactivity can vary based on environmental conditions, such as pH and temperature, making it important to consider these factors in practical applications.
Formula:C10H13N
InChI:InChI=1S/C10H13N/c11-10-7-3-5-8-4-1-2-6-9(8)10/h1-2,4,6,10H,3,5,7,11H2
InChI key:InChIKey=JRZGPXSSNPTNMA-UHFFFAOYSA-N
SMILES:NC1C=2C=CC=CC2CCC1
- Synonyms:
- (1R)-1,2,3,4-tetrahydronaphthalen-1-aminium
- (1S)-1,2,3,4-tetrahydronaphthalen-1-aminium
- (RS)-1,2,3,4-Tetrahydro-1-naphthylamine
- (RS)-1-Aminotetralin
- (±)-1,2,3,4-Tetrahydro-α-naphthylamine
- 1,2,3,4-Tetrahydro-1-aminonaphthalene
- 1,2,3,4-Tetrahydro-1-naphthalenamine
- 1,2,3,4-Tetrahydronaphthalen-1-Amine
- 1,2,3,4-Tetrahydronaphthalen-1-ylamine
- 1-Amino-1,2,3,4-tetrahydronaphthalene
- See more synonyms
- 1-Aminotetralin
- 1-Aminotetraline
- 1-Naphthalenamine, 1,2,3,4-tetrahydro-
- 1-Naphthylamine, 1,2,3,4-tetrahydro-, (±)-
- N-(phenylacetyl)glycine
- NSC 30349
