CAS 22190-40-5: 1-(6-Bromo-3,4-dihydro-1(2H)-quinolinyl)ethanone
Description:1-(6-Bromo-3,4-dihydro-1(2H)-quinolinyl)ethanone, with the CAS number 22190-40-5, is a chemical compound characterized by its unique structure, which includes a quinoline moiety substituted with a bromine atom and an ethanone functional group. This compound typically exhibits properties associated with both the quinoline and ketone functional groups, such as potential biological activity and reactivity. The presence of the bromine atom may enhance its lipophilicity and influence its interaction with biological targets. It is often studied in the context of medicinal chemistry due to its potential pharmacological properties, including antimicrobial or anticancer activities. The compound's synthesis may involve various organic reactions, including bromination and acylation processes. As with many organic compounds, its physical properties, such as solubility and melting point, can vary based on the specific conditions and purity of the sample. Safety data should be consulted for handling and storage, as halogenated compounds can pose specific health and environmental risks.
Formula:C11H12BrNO
InChI:InChI=1S/C11H12BrNO/c1-8(14)13-6-2-3-9-7-10(12)4-5-11(9)13/h4-5,7H,2-3,6H2,1H3
InChI key:InChIKey=BHQKJGRWIRTURN-UHFFFAOYSA-N
SMILES:O=C(N1C2=CC=C(Br)C=C2CCC1)C
- Synonyms:
- 1-(6-Bromo-3,4-dihydro-1(2H)-quinolinyl)ethanone
- 1-(6-Bromo-3,4-dihydro-2H-quinolin-1-yl)ethanone
- 1-(6-bromo-3,4-dihydroquinolin-1(2H)-yl)ethanone
- 1-Acetyl-6-bromo-1,2,3,4-tetrahydro-quinoline
- Ethanone, 1-(6-bromo-3,4-dihydro-1(2H)-quinolinyl)-
- Quinoline, 1-acetyl-6-bromo-1,2,3,4-tetrahydro-
- 1-Acetyl-6-bromo-1,2,3,4-tetrahydroquinoline
1-(6-Bromo-3,4-dihydroquinolin-1(2H)-yl)ethanone
Ref: IN-DA003DWO
| 1g | 56.00 € | ||
| 5g | 122.00 € | ||
| 10g | 155.00 € | ||
| 25g | 334.00 € | ||
| 250mg | 35.00 € |
1-(6-Bromo-3,4-dihydroquinolin-1(2H)-yl)ethanone
Ref: 3D-XAA19040
| 10g | 448.00 € |
