CAS 2224-00-2: 2-Ethoxy-1-naphthalenecarboxylic acid
Description:2-Ethoxy-1-naphthalenecarboxylic acid is an organic compound characterized by its naphthalene structure, which is a fused bicyclic aromatic hydrocarbon. This compound features an ethoxy group (-OCH2CH3) and a carboxylic acid group (-COOH) attached to the naphthalene ring, contributing to its chemical reactivity and solubility properties. It typically appears as a solid at room temperature and is soluble in organic solvents, while exhibiting limited solubility in water due to its hydrophobic naphthalene core. The presence of the carboxylic acid group allows for potential acid-base reactions, while the ethoxy group can participate in various chemical transformations, including esterification and nucleophilic substitutions. This compound may be utilized in organic synthesis, pharmaceuticals, or as an intermediate in the production of other chemical entities. Its specific physical and chemical properties, such as melting point, boiling point, and spectral characteristics, can vary based on purity and environmental conditions. Safety data should be consulted for handling and storage, as with any chemical substance.
Formula:C13H12O3
InChI:InChI=1S/C13H12O3/c1-2-16-11-8-7-9-5-3-4-6-10(9)12(11)13(14)15/h3-8H,2H2,1H3,(H,14,15)
InChI key:InChIKey=MYFBSSDLYGWAHH-UHFFFAOYSA-N
SMILES:O=C(O)C1=C(OCC)C=CC=2C=CC=CC21
- Synonyms:
- 1-Naphthalenecarboxylic acid, 2-ethoxy-
- 1-Naphthoic acid, 2-ethoxy-
- 2-Ethoxy-1-Naphthalenecarboxylic Acid
- 2-Ethoxynaphthalene-1-Carboxylate
- 2-Ethoxynaphthalene-1-Carboxylic Acid
- 2-Ethoxy-1-naphthoic acid
