CAS 222529-65-9: 2,2′,2′′-(1,3,5-Triazine-2,4,6-triyl)tris[5-(hexyloxy)-6-methylphenol]

Description: The chemical substance known as "2,2′,2′′-(1,3,5-Triazine-2,4,6-triyl)tris[5-(hexyloxy)-6-methylphenol]" with CAS number 222529-65-9 is a complex organic compound characterized by its triazine core structure, which is a six-membered aromatic ring containing three nitrogen atoms. This compound features three substituent groups, each consisting of a 5-(hexyloxy)-6-methylphenol moiety, contributing to its hydrophobic properties and potential applications in various fields, including materials science and organic electronics. The presence of the hexyloxy groups enhances solubility in organic solvents, while the methylphenol units may impart antioxidant properties. The triazine framework is known for its stability and ability to participate in various chemical reactions, making this compound of interest in the development of functional materials. Its unique structure may also allow for specific interactions with biological systems, suggesting potential applications in pharmaceuticals or agrochemicals. Overall, this compound exemplifies the intersection of organic chemistry and material science, showcasing the versatility of triazine derivatives.

Formula: C₄₂H₅₇N₃O₆

InChI: InChI=1S/C42H57N3O6/c1-7-10-13-16-25-49-34-22-19-31(37(46)28(34)4)40-43-41(32-20-23-35(29(5)38(32)47)50-26-17-14-11-8-2)45-42(44-40)33-21-24-36(30(6)39(33)48)51-27-18-15-12-9-3/h19-24,46-48H,7-18,25-27H2,1-6H3

InChI key: InChIKey=DFANMEUHPMJFDO-UHFFFAOYSA-N

SMILES: OC1=C(C=CC(OCCCCCC)=C1C)C=2N=C(N=C(N2)C=3C=CC(OCCCCCC)=C(C3O)C)C=4C=CC(OCCCCCC)=C(C4O)C

Synonyms:

• T 712
• 2,2′,2′′-(1,3,5-Triazine-2,4,6-triyl)tris[5-(hexyloxy)-6-methylphenol]
• Phenol, 2,2′,2′′-(1,3,5-triazine-2,4,6-triyl)tris[5-(hexyloxy)-6-methyl-
• Tris[2-hydroxy-3-methyl-4-hexyloxyphenyl]-1,3,5-triazine
• ADK Stab LA-F 70

2,4,6-Tris-(2-hydroxy-4-hexyloxy-3-methylphenyl)-1,3,5-triazine

CAS: 222529-65-9

• Molecular weight: 699.92g/mol