CAS 2232-49-7: 10H-Phenothiazine-10-propanamine, 2-chloro-, 5-oxide

Description:10H-Phenothiazine-10-propanamine, 2-chloro-, 5-oxide, with the CAS number 2232-49-7, is a chemical compound that belongs to the phenothiazine class, which is characterized by a tricyclic structure containing sulfur and nitrogen atoms. This compound typically exhibits properties such as being a solid at room temperature, with potential applications in pharmaceuticals, particularly as an antipsychotic or antihistamine agent. The presence of the chlorine atom and the oxide functional group can influence its reactivity and biological activity. The compound may also display moderate solubility in organic solvents, while its solubility in water can vary based on pH and other conditions. Additionally, phenothiazines are known for their ability to interact with various biological targets, which can lead to diverse pharmacological effects. Safety data should be consulted for handling and exposure guidelines, as compounds in this class can have significant biological effects and potential toxicity.

Formula:C₁₅H₁₅ClN₂OS

InChI:InChI=1S/C15H15ClN2OS/c16-11-6-7-15-13(10-11)18(9-3-8-17)12-4-1-2-5-14(12)20(15)19/h1-2,4-7,10H,3,8-9,17H2

InChI key:InChIKey=YGJLHHBXRHEYRU-UHFFFAOYSA-N

SMILES:O=S1C=2C=CC=CC2N(C3=CC(Cl)=CC=C31)CCCN

Synonyms:
10H-Phenothiazine-10-propanamine, 2-chloro-, 5-oxide
Nor2Chlorpromazine sulfoxide
Didemethylchlorpromazine sulfoxide
Desdimethylchlorpromazine sulphoxide
Phenothiazine, 10-(3-aminopropyl)-2-chloro-, 5-oxide

Found 3 products.

Product data	Purity	Price range	Estimated delivery
didemethylchlorpromazine sulfoxide REF: IN-DA00BJ9BCAS: 2232-49-7	95%	To inquire	Thu 27 Mar 25
10-(3-Aminopropyl)-2-chloro-10H-phenothiazine 5-oxide REF: 10-F614502CAS: 2232-49-7	95%	To inquire	Tue 08 Apr 25
10-(3-aminopropyl)-2-chloro-10H-5'-phenothiazin-5-one REF: 3D-CAA23249CAS: 2232-49-7	Min. 95%	- - -	Discontinued product