CAS 223668-64-2: 1,2,3,4,5-Pentafluoro-6-(trimethoxysilyl)benzene
Description:1,2,3,4,5-Pentafluoro-6-(trimethoxysilyl)benzene is a fluorinated aromatic compound characterized by the presence of five fluorine atoms attached to a benzene ring, along with a trimethoxysilyl group. This unique structure imparts significant hydrophobic and lipophobic properties, making it useful in various applications, particularly in surface modification and coatings. The trimethoxysilyl group allows for chemical bonding to silicate surfaces, enhancing adhesion and stability in composite materials. The presence of multiple fluorine atoms contributes to its thermal stability and chemical resistance, making it suitable for use in harsh environments. Additionally, the compound's low surface energy can reduce friction and improve the performance of coatings. Its synthesis typically involves fluorination reactions and silane chemistry, and it is important to handle this compound with care due to the potential hazards associated with fluorinated chemicals. Overall, 1,2,3,4,5-Pentafluoro-6-(trimethoxysilyl)benzene is a versatile compound with applications in materials science and nanotechnology.
Formula:C9H9F5O3Si
InChI:InChI=1S/C9H9F5O3Si/c1-15-18(16-2,17-3)9-7(13)5(11)4(10)6(12)8(9)14/h1-3H3
InChI key:InChIKey=XFFHTZIRHGKTBQ-UHFFFAOYSA-N
SMILES:FC=1C(F)=C(F)C(=C(F)C1F)[Si](OC)(OC)OC
- Synonyms:
- 1,2,3,4,5-Pentafluoro-6-(trimethoxysilyl)benzene
- Benzene, 1,2,3,4,5-Pentafluoro-6-(Trimethoxysilyl)-
- Pentafluorophenyltrimethoxysilane
- Silane, trimethoxy(pentafluorophenyl)-

Trimethoxy(pentafluorophenyl)silane
Ref: 3B-T3352
1g | 95.00 € | ||
5g | 288.00 € |

Benzene,1,2,3,4,5-pentafluoro-6-(trimethoxysilyl)-
Ref: IN-DA006Y6Q
1g | 76.00 € | ||
5g | 165.00 € | ||
25g | To inquire | ||
250mg | 46.00 € |

Trimethoxy(pentafluorophenyl)silane
Ref: 54-PC10094
1g | 61.00 € | ||
5g | 205.00 € | ||
25g | 860.00 € |

Pentafluorophenyltrimethoxysilane
Ref: 10-S25338
1g | 56.00 € | ||
5g | 136.00 € | ||
25g | 585.00 € |

Trimethoxy(Pentafluorophenyl)Silane
Ref: 3D-FT82457
1g | Discontinued | Request information | |
5g | Discontinued | Request information | |
500mg | Discontinued | Request information |