CAS 22393-85-7: Tetradecyl oleate
Description:Tetradecyl oleate is an ester formed from tetradecanol (a long-chain alcohol) and oleic acid (a monounsaturated fatty acid). It is characterized by its long hydrophobic carbon chain, which contributes to its surfactant properties and makes it soluble in organic solvents while being insoluble in water. This compound typically appears as a colorless to pale yellow liquid with a mild odor. Tetradecyl oleate is often used in cosmetic formulations, as it acts as an emollient, providing a smooth texture and enhancing skin feel. Additionally, it can serve as a lubricant and a dispersing agent in various applications. Its chemical structure allows it to exhibit low toxicity and good compatibility with other ingredients, making it suitable for use in personal care products. However, like many esters, it may undergo hydrolysis in the presence of moisture, leading to the release of the parent alcohol and acid. Overall, tetradecyl oleate is valued for its functional properties in both industrial and cosmetic applications.
Formula:C32H62O2
InChI:InChI=1S/C32H62O2/c1-3-5-7-9-11-13-15-17-18-19-20-22-24-26-28-30-32(33)34-31-29-27-25-23-21-16-14-12-10-8-6-4-2/h17-18H,3-16,19-31H2,1-2H3/b18-17-
InChI key:InChIKey=DHZWALZKPWZSMA-ZCXUNETKSA-N
SMILES:O=C(OCCCCCCCCCCCCCC)CCCCCCCC=CCCCCCCCC
- Synonyms:
- 9-Octadecenoic acid (9Z)-, tetradecyl ester
- 9-Octadecenoic acid (Z)-, tetradecyl ester
- Myristyl oleate
- Oleic acid myristyl ester
- Oleic acid, tetradecyl ester
- tetradecyl (9Z)-octadec-9-enoate
- Tetradecyl oleate
- Tetradecyl oleate
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | Myristyl Oleate REF: 48-45-3814CAS: 22393-85-7 | >99% | 67.00 €~185.00 € | Mon 31 Mar 25 |
![]() | Myristyl oleate REF: 3D-XAA39385CAS: 22393-85-7 | Min. 95% | - - - | Discontinued product |

Myristyl Oleate
Ref: 48-45-3814
1g | 185.00 € | ||
100mg | 67.00 € |

Myristyl oleate
Ref: 3D-XAA39385
1g | Discontinued | Request information | |
5g | Discontinued | Request information | |
100mg | Discontinued | Request information | |
250mg | Discontinued | Request information | |
500mg | Discontinued | Request information |