CAS 2250242-33-0: 4-Pyridineethanol, β-amino-, hydrochloride (1:2), (βS)-
Description:4-Pyridineethanol, β-amino-, hydrochloride (1:2), (βS)- is a chemical compound characterized by its pyridine and amino alcohol functional groups. It typically appears as a white to off-white crystalline solid, soluble in water due to the presence of the hydrochloride salt form, which enhances its solubility compared to the free base. The compound is chiral, with the (βS)- designation indicating its specific stereochemistry, which can influence its biological activity and interactions. It may exhibit properties typical of both pyridine derivatives and amino alcohols, such as potential roles in biological systems, including neurotransmitter modulation or as intermediates in organic synthesis. The hydrochloride form suggests it can act as a proton donor, making it relevant in various chemical reactions. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken. Overall, this compound's unique structure and properties make it of interest in both research and potential applications in pharmaceuticals or agrochemicals.
Formula:C7H10N2O·2ClH
InChI:InChI=1S/C7H10N2O.2ClH/c8-7(5-10)6-1-3-9-4-2-6;;/h1-4,7,10H,5,8H2;2*1H/t7-;;/m1../s1
InChI key:InChIKey=XLAMHJAZOJEAEP-XCUBXKJBSA-N
SMILES:Cl.OCC(N)C=1C=CN=CC1
- Synonyms:
- 4-Pyridineethanol, β-amino-, hydrochloride (1:2), (βS)-
(S)-2-Amino-2-(pyridin-4-yl)ethanoldihydrochloride
Ref: IN-DA01KKGG
| 1g | 277.00 € | ||
| 100mg | 64.00 € | ||
| 250mg | 101.00 € |
(S)-2-Amino-2-(pyridin-4-yl)ethan-1-ol dihydrochloride
Ref: 54-OR81814
| 1g | 551.00 € |
(S)-2-Amino-2-(pyridin-4-yl)ethan-1-ol dihydrochloride
Ref: 10-F620984
| 1g | 286.00 € |
(S)-2-Amino-2-(pyridin-4-yl)ethan-1-ol dihydrochloride
Ref: 3D-AQD24233
| 500mg | Discontinued | Request information |
