CAS 22510-33-4: 4′-Fluoro-4-hydroxy[1,1′-biphenyl]-3-carboxylic acid

Description:4′-Fluoro-4-hydroxy[1,1′-biphenyl]-3-carboxylic acid, identified by its CAS number 22510-33-4, is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. This compound features a fluorine atom and a hydroxyl group (-OH) at the para position relative to each other on one of the phenyl rings, as well as a carboxylic acid group (-COOH) at the meta position on the other ring. The presence of these functional groups contributes to its potential as a versatile building block in organic synthesis and pharmaceuticals. The fluorine substituent can enhance the compound's lipophilicity and biological activity, while the hydroxyl and carboxylic acid groups can participate in hydrogen bonding and influence solubility in polar solvents. Additionally, the compound may exhibit interesting chemical reactivity due to the electron-withdrawing nature of the fluorine atom and the electron-donating properties of the hydroxyl group, making it a subject of interest in medicinal chemistry and materials science.

Formula:C₁₃H₉FO₃

InChI:InChI=1S/C13H9FO3/c14-10-4-1-8(2-5-10)9-3-6-12(15)11(7-9)13(16)17/h1-7,15H,(H,16,17)

InChI key:InChIKey=CUXSCHTUWINJSV-UHFFFAOYSA-N

SMILES:O=C(O)C1=CC(=CC=C1O)C=2C=CC(F)=CC2

Synonyms:
2-Hydroxy-5-(4-fluorophenyl)benzoic acid
3-Biphenylcarboxylic acid, 4′-fluoro-4-hydroxy-
4′-Fluoro-4-hydroxy[1,1′-biphenyl]-3-carboxylic acid
5-(4-Fluorophenyl)salicylic acid
5-p-Fluorophenylsalicylic acid
Desacetylflufenisal
[1,1'-Biphenyl]-3-carboxylic acid, 4'-fluoro-4-hydroxy-
4'-Fluoro-4-hydroxybiphenyl-3-carboxylic acid

Found 3 products.

Product data	Purity	Price range	Estimated delivery
4'-Fluoro-4-hydroxy-[1,1'-biphenyl]-3-carboxylic acid REF: 54-PC11150CAS: 22510-33-4	- - -	To inquire	Fri 28 Mar 25
4'-Fluoro-4-hydroxy-[1,1'-biphenyl]-3-carboxylic acid REF: 10-F655948CAS: 22510-33-4	98%	- - -	Discontinued product
4'-Fluoro-4-Hydroxy-3-Biphenylcarboxylic Acid REF: 3D-FF89007CAS: 22510-33-4	Min. 95%	- - -	Discontinued product