CAS 22568-49-6: 4-[(1E)-2-Nitroethenyl]phenol
Description:4-[(1E)-2-Nitroethenyl]phenol, with the CAS number 22568-49-6, is an organic compound characterized by its phenolic structure and a nitroethenyl substituent. This compound features a phenol group, which is a hydroxyl (-OH) group attached to a benzene ring, contributing to its potential reactivity and solubility in polar solvents. The presence of the nitroethenyl group introduces both electron-withdrawing characteristics and potential sites for further chemical reactions, making it of interest in various synthetic applications. The compound may exhibit biological activity, which could be relevant in fields such as medicinal chemistry or agrochemicals. Its physical properties, such as melting point, boiling point, and solubility, would depend on the specific molecular interactions and the presence of functional groups. Safety data should be consulted for handling and storage, as compounds with nitro groups can sometimes be sensitive or hazardous. Overall, 4-[(1E)-2-Nitroethenyl]phenol represents a versatile structure in organic synthesis and research.
Formula:C8H7NO3
InChI:InChI=1S/C8H7NO3/c10-8-3-1-7(2-4-8)5-6-9(11)12/h1-6,10H/b6-5+
InChI key:InChIKey=CTJKRKMPTRJAIT-AATRIKPKSA-N
SMILES:O=N(=O)C=CC1=CC=C(O)C=C1
- Synonyms:
- Phenol, p-(2-nitrovinyl)-, (E)-
- Phenol, 4-(2-nitroethenyl)-, (E)-
- Phenol, 4-[(1E)-2-nitroethenyl]-
- 4-[(1E)-2-Nitroethenyl]phenol
- Trans-p-hydroxy-β-nitrostyrene
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | (E)-4-(2-Nitrovinyl)phenol REF: IN-DA003UY4CAS: 22568-49-6 | 97% | 46.00 €~179.00 € | Thu 27 Mar 25 |
![]() | trans-4-Hydroxy-β-nitrostyrene REF: 7W-GL7436CAS: 22568-49-6 | - - - | To inquire | Fri 28 Mar 25 |
![]() | trans-p-Hydroxy-β-nitrostyrene REF: 3D-FH182627CAS: 22568-49-6 | Min. 95% | - - - | Discontinued product |

(E)-4-(2-Nitrovinyl)phenol
Ref: IN-DA003UY4
1g | 46.00 € |

trans-p-Hydroxy-β-nitrostyrene
Ref: 3D-FH182627
1g | Discontinued | Request information | |
2g | Discontinued | Request information | |
5g | Discontinued | Request information | |
10g | Discontinued | Request information | |
25g | Discontinued | Request information |