CAS 22713-35-5: 1,3-dimethyl-1H-benzotriazol-3-ium iodide
Description:1,3-Dimethyl-1H-benzotriazol-3-ium iodide is a chemical compound characterized by its structure, which includes a benzotriazole moiety with two methyl groups attached to the nitrogen atoms. This compound is typically a quaternary ammonium salt, where the iodide ion serves as the counterion. It is known for its applications in various fields, including organic synthesis and as a photostabilizer in polymers due to its ability to absorb ultraviolet light. The presence of the benzotriazole ring contributes to its stability and reactivity, making it useful in various chemical reactions. Additionally, it may exhibit properties such as solubility in polar solvents and potential antimicrobial activity. Safety data should be consulted, as with any chemical, to understand its handling and toxicity. Overall, 1,3-dimethyl-1H-benzotriazol-3-ium iodide is a versatile compound with significant utility in both research and industrial applications.
Formula:C8H10IN3
InChI:InChI=1/C8H10N3.HI/c1-10-7-5-3-4-6-8(7)11(2)9-10;/h3-6H,1-2H3;1H/q+1;/p-1
- Synonyms:
- 1H-1,2,3-benzotriazolium, 1,3-dimethyl-, iodide (1:1)
| Brand | Product data | Purity | Price range | Estimated delivery |
|---|---|---|---|---|
 | 1,3-Dimethyl-1H-1,2,3-benzotriazol-3-ium iodide REF: 10-F182061CAS: 22713-35-5 | - - - | To inquire | Tue 08 Apr 25 |
Ref: 10-F182061
| 500mg | To inquire |
