CAS 227619-96-7: (1Z)-5-Fluoro-2-methyl-N-(phenylmethyl)-1-(4-pyridinylmethylene)-1H-indene-3-acetamide hydrochloride (1:1)

Description:(1Z)-5-Fluoro-2-methyl-N-(phenylmethyl)-1-(4-pyridinylmethylene)-1H-indene-3-acetamide hydrochloride is a synthetic organic compound characterized by its complex structure, which includes an indene core, a fluorine substituent, and a pyridine moiety. This compound typically exhibits properties such as moderate solubility in polar solvents and potential bioactivity, making it of interest in medicinal chemistry. The presence of the fluorine atom can enhance lipophilicity and metabolic stability, while the indene and pyridine rings may contribute to its pharmacological profile. As a hydrochloride salt, it is likely to be more stable and easier to handle than its free base form. The compound may interact with biological targets, potentially influencing pathways related to neurotransmission or other cellular processes. Its specific applications and effects would depend on further studies, including pharmacokinetics and toxicity assessments. Overall, this compound represents a class of molecules that could be explored for therapeutic uses, particularly in areas related to neurological or psychiatric disorders.

Formula:C₂₅H₂₁FN₂O·ClH

InChI:InChI=1S/C25H21FN2O.ClH/c1-17-22(13-18-9-11-27-12-10-18)21-8-7-20(26)14-24(21)23(17)15-25(29)28-16-19-5-3-2-4-6-19;/h2-14H,15-16H2,1H3,(H,28,29);1H/b22-13-;

InChI key:InChIKey=KGXPDNOBLLACKL-BWLGBDCWSA-N

SMILES:Cl.O=C(NCC=1C=CC=CC1)CC=2C=3C=C(F)C=CC3C(=CC=4C=CN=CC4)C2C

Synonyms:
(1Z)-5-Fluoro-2-methyl-N-(phenylmethyl)-1-(4-pyridinylmethylene)-1H-indene-3-acetamide hydrochloride (1:1)
1H-Indene-3-acetamide, 5-fluoro-2-methyl-N-(phenylmethyl)-1-(4-pyridinylmethylene)-, monohydrochloride, (1Z)-
CP 461
OSI 461
1H-Indene-3-acetamide, 5-fluoro-2-methyl-N-(phenylmethyl)-1-(4-pyridinylmethylene)-, hydrochloride (1:1), (1Z)-