CAS 22843-73-8: 5,10,15,20-tetrakis(4-nitrophenyl)porphyrin
Description:5,10,15,20-Tetrakis(4-nitrophenyl)porphyrin is a synthetic porphyrin compound characterized by its complex structure, which includes a porphyrin core with four 4-nitrophenyl substituents. This compound exhibits strong absorption in the visible region of the electromagnetic spectrum, making it useful in various applications such as photodynamic therapy, sensors, and as a dye in solar energy conversion. The presence of nitro groups enhances its electron-accepting properties, contributing to its potential in electronic and photonic devices. Additionally, the compound is known for its stability and solubility in organic solvents, which facilitates its use in various chemical reactions and applications. Its unique electronic properties and ability to form coordination complexes with metal ions further expand its utility in catalysis and materials science. Overall, 5,10,15,20-tetrakis(4-nitrophenyl)porphyrin is a versatile compound with significant implications in both research and industrial applications.
Formula:C44H26N8O8
InChI:InChI=1/C44H26N8O8/c53-49(54)29-9-1-25(2-10-29)41-33-17-19-35(45-33)42(26-3-11-30(12-4-26)50(55)56)37-21-23-39(47-37)44(28-7-15-32(16-8-28)52(59)60)40-24-22-38(48-40)43(36-20-18-34(41)46-36)27-5-13-31(14-6-27)51(57)58/h1-24,45,48H/b41-33-,41-34-,42-35-,42-37-,43-36-,43-38-,44-39-,44-40-
- Synonyms:
- 21H,23H-porphine, 5,10,15,20-tetrakis(4-nitrophenyl)-
- 5,10,15,20-Tetrakis(4-nitrophenyl)porphyrin