CAS 22913-25-3: Benzothiophene-3-carboxylic acid methyl ester

Description:Benzothiophene-3-carboxylic acid methyl ester is an organic compound characterized by its benzothiophene core structure, which consists of a fused benzene and thiophene ring. This compound features a carboxylic acid functional group that is esterified with a methyl group, contributing to its reactivity and solubility properties. It typically appears as a solid or liquid, depending on the specific conditions, and is known for its aromatic characteristics, which can influence its chemical behavior and interactions. The presence of the thiophene ring imparts unique electronic properties, making it of interest in various fields, including organic synthesis and materials science. Benzothiophene derivatives are often studied for their potential applications in pharmaceuticals, agrochemicals, and as intermediates in organic reactions. Additionally, the compound may exhibit biological activity, although specific biological properties would require further investigation. As with many organic compounds, safety and handling precautions should be observed, particularly regarding its potential toxicity and environmental impact.

Formula:C₁₀H₈O₂S

InChI:InChI=1S/C10H8O2S/c1-12-10(11)8-6-13-9-5-3-2-4-7(8)9/h2-6H,1H3

InChI key:InChIKey=FSJAXBXCHWMNAB-UHFFFAOYSA-N

SMILES:O=C(OC)C1=CSC=2C=CC=CC21

Synonyms:
Benzo[b]thiophene-3-carboxylic acid, methyl ester
Benzothiophene-3-carboxylic acid methyl ester
3-(Methoxycarbonyl)benzo[b]thiophene

Found 4 products.

Product data	Purity	Price range	Estimated delivery
Benzo[b]thiophene-3-carboxylic acid, methyl ester REF: IN-DA002LHHCAS: 22913-25-3	98%	70.00 €~577.00 €	Thu 27 Mar 25
Methyl benzothiophene-3-carboxylate REF: 54-OR955809CAS: 22913-25-3	98%	120.00 €~992.00 €	Fri 28 Mar 25
Methyl benzothiophene-3-carboxylate REF: 10-F626690CAS: 22913-25-3	98%	To inquire	Tue 08 Apr 25
Methyl benzothiophene-3-carboxylate REF: 3D-XAA91325CAS: 22913-25-3	Min. 95%	To inquire	Thu 08 May 25