CAS 2305-26-2: rel-(1R,2S)-4-Cyclohexene-1,2-dicarboxylic acid
Description:Rel-(1R,2S)-4-Cyclohexene-1,2-dicarboxylic acid, with the CAS number 2305-26-2, is an organic compound characterized by its bicyclic structure featuring a cyclohexene ring with two carboxylic acid functional groups. This compound exhibits stereoisomerism due to the presence of chiral centers at the 1 and 2 positions of the cyclohexene ring, leading to specific optical activity. The dicarboxylic acid nature of the molecule contributes to its acidity and reactivity, allowing it to participate in various chemical reactions, such as esterification and amidation. Its structural features may influence its solubility in polar and non-polar solvents, as well as its potential applications in organic synthesis and materials science. Additionally, the compound's unique configuration may impart specific biological activities, making it of interest in medicinal chemistry. Overall, rel-(1R,2S)-4-Cyclohexene-1,2-dicarboxylic acid is a versatile compound with significant implications in both synthetic and applied chemistry.
Formula:C8H10O4
InChI:InChI=1/C8H10O4/c9-7(10)5-3-1-2-4-6(5)8(11)12/h1-2,5-6H,3-4H2,(H,9,10)(H,11,12)/t5-,6+
InChI key:InChIKey=ILUAAIDVFMVTAU-OLQVQODUNA-N
SMILES:O=C(O)C1CC=CCC1C(=O)O
- Synonyms:
- (1R,2S)-Cyclohex-4-ene-1,2-dicarboxylic acid
- 1-Cyclohexene-4,5-cis-dicarboxylic acid
- 4-Cyclohexene-1,2-dicarboxylic acid, (1R,2S)-rel-
- 4-Cyclohexene-1,2-dicarboxylic acid, cis-
- 4-cyclohexene-1,2-dicarboxylic acid, (1R,2S)-
- Cis-4-cyclohexene-1,2-dicarboxylic acid
- cis-1,2,3,6-Tetrahydrophthalic acid
- cis-1,2-Cyclohex-4-enedicarboxylic acid
- cis-Cyclohexene-4,5-dicarboxylic acid
- cis-Δ<sup>4</sup>-Cyclohexene-1,2-dicarboxylic acid
- See more synonyms
- cis-Δ<sup>4</sup>-Tetrahydrophthalic acid
- rel-(1R,2S)-4-Cyclohexene-1,2-dicarboxylic acid
