CAS 2305-32-0: (±)-trans-1,2-Cyclohexanedicarboxylic acid
Description:(±)-trans-1,2-Cyclohexanedicarboxylic acid, also known as trans-1,2-cyclohexanedicarboxylic acid, is a bicyclic organic compound characterized by the presence of two carboxylic acid functional groups attached to a cyclohexane ring. This compound exists as a racemic mixture, meaning it contains equal amounts of both enantiomers, which can exhibit different properties. It is typically a white crystalline solid at room temperature and is soluble in polar solvents like water and alcohols, owing to the hydrophilic nature of the carboxylic acid groups. The compound is used in various applications, including as a building block in organic synthesis and in the production of polymers. Its structural configuration contributes to its unique chemical reactivity, making it a valuable intermediate in the synthesis of more complex molecules. Additionally, (±)-trans-1,2-Cyclohexanedicarboxylic acid can participate in various chemical reactions, such as esterification and amidation, further expanding its utility in chemical research and industry.
Formula:C8H12O4
InChI:InChI=1/C8H12O4/c9-7(10)5-3-1-2-4-6(5)8(11)12/h5-6H,1-4H2,(H,9,10)(H,11,12)/t5-,6-/s2
InChI key:InChIKey=QSAWQNUELGIYBC-IOMOGOHMNA-N
SMILES:O=C(O)C1CCCCC1C(=O)O
- Synonyms:
- (1R,2R)-cyclohexane-1,2-dicarboxylate
- (1R,2S)-cyclohexane-1,2-dicarboxylic acid
- (1S,2S)-cyclohexane-1,2-dicarboxylic acid
- 1,2-Cyclohexanedicarboxylic acid, (1R,2R)-rel-
- 1,2-Cyclohexanedicarboxylic acid, trans-
- Lurasidone Intermediate(1)
- NSC 31593
- Trans-1,2-Cyclohexanedicarboxylicacid
- rel-(1R,2R)-1,2-Cyclohexanedicarboxylic acid
- trans-1,2-Cyclohexanedicarboxylic acid
- See more synonyms
- trans-Hexahydrophthalic acid
