CAS 2305-79-5: 4,5,6,7-Tetrahydro-1H-indazole
Description:4,5,6,7-Tetrahydro-1H-indazole is a bicyclic organic compound characterized by its indazole structure, which consists of a five-membered ring fused to a six-membered ring. This compound features a saturated tetrahydro configuration, indicating the presence of four hydrogen atoms added to the indazole framework, resulting in a more stable, saturated form. It is typically a colorless to pale yellow liquid or solid, depending on its purity and form. The compound is known for its potential applications in medicinal chemistry, particularly in the development of pharmaceuticals due to its ability to interact with various biological targets. Its molecular formula reflects a moderate molecular weight, and it exhibits moderate solubility in organic solvents. The presence of nitrogen atoms in its structure contributes to its basicity and potential reactivity in various chemical reactions. Safety data indicates that, like many organic compounds, it should be handled with care, as it may pose health risks if ingested or inhaled. Overall, 4,5,6,7-Tetrahydro-1H-indazole is a compound of interest in both synthetic and medicinal chemistry.
Formula:C7H10N2
InChI:InChI=1S/C7H10N2/c1-2-4-7-6(3-1)5-8-9-7/h5H,1-4H2,(H,8,9)
InChI key:InChIKey=GDSQTWDUCDSZEY-UHFFFAOYSA-N
SMILES:N1=CC2=C(N1)CCCC2
- Synonyms:
- 1H-Indazole, 4,5,6,7-tetrahydro-
- 4,5,6,7-Tetrahydro-1H-indazole
- NSC 195333
- 4,5,6,7-Tetrahydroindazole
| Brand | Product data | Purity | Price range | Estimated delivery |
|---|---|---|---|---|
 | 1h-indazole, 4,5,6,7-tetrahydro- REF: IN-DA002M0CCAS: 2305-79-5 | 97% | To inquire | Thu 27 Mar 25 |
 | 4,5,6,7-Tetrahydro-1H-indazole REF: 10-F324948CAS: 2305-79-5 | 95.0% | 23.00 €~781.00 € | Tue 01 Apr 25 |
 | 4,5,6,7-Tetrahydroindazole REF: 54-OR909279CAS: 2305-79-5 | 98% | 101.00 €~920.00 € | Thu 03 Apr 25 |
 | 4,5,6,7-Tetrahydro-2H-indazole REF: 3D-FT137015CAS: 2305-79-5 | Min. 95% | - - - | Discontinued product |
1h-indazole, 4,5,6,7-tetrahydro-
Ref: IN-DA002M0C
| 1g | 37.00 € | ||
| 5g | 72.00 € | ||
| 10g | 114.00 € | ||
| 25g | 172.00 € | ||
| 250mg | 34.00 € |
4,5,6,7-Tetrahydro-1H-indazole
Ref: 10-F324948
| 1g | 23.00 € | ||
| 5g | 76.00 € | ||
| 10g | 112.00 € | ||
| 100g | 781.00 € |
4,5,6,7-Tetrahydro-2H-indazole
Ref: 3D-FT137015
| 1g | Discontinued | Request information | |
| 2g | Discontinued | Request information | |
| 5g | Discontinued | Request information | |
| 250mg | Discontinued | Request information | |
| 500mg | Discontinued | Request information |
