CAS 2308-61-4: 3,6-Dibenzyl-2,5-dioxopiperazine

Description:3,6-Dibenzyl-2,5-dioxopiperazine is a chemical compound characterized by its piperazine core, which is a six-membered ring containing two nitrogen atoms. This compound features two benzyl groups attached to the 3 and 6 positions of the piperazine ring, contributing to its structural complexity and potential for various interactions. The presence of the dioxo functional groups at the 2 and 5 positions indicates that it contains two carbonyl groups, which can participate in hydrogen bonding and other chemical reactions. This compound is typically used in organic synthesis and may exhibit biological activity, making it of interest in medicinal chemistry. Its properties, such as solubility, melting point, and reactivity, can vary based on the specific conditions and solvents used. As with many organic compounds, safety precautions should be taken when handling it, as it may pose health risks or environmental hazards. Overall, 3,6-Dibenzyl-2,5-dioxopiperazine is a versatile compound with potential applications in various fields of chemistry.

Formula:C₁₈H₁₈N₂O₂

InChI:InChI=1S/C18H18N2O2/c21-17-15(11-13-7-3-1-4-8-13)19-18(22)16(20-17)12-14-9-5-2-6-10-14/h1-10,15-16H,11-12H2,(H,19,22)(H,20,21)

InChI key:InChIKey=JUAPMRSLDANLAS-UHFFFAOYSA-N

SMILES:O=C1NC(C(=O)NC1CC=2C=CC=CC2)CC=3C=CC=CC3

Synonyms:
3,6-Bis(phenylmethyl)-2,5-piperazinedione
2,5-Piperazinedione, 3,6-bis(phenylmethyl)-
3,6-Dibenzyl-2,5-piperazinedione
3,6-Dibenzyl-2,5-dioxopiperazine
2,5-Piperazinedione, 3,6-dibenzyl-

Found 3 products.

Product data	Purity	Price range	Estimated delivery
Bortezomib Impurity 67 REF: 4Z-B-4683CAS: 2308-61-4	- - -	To inquire	Thu 03 Apr 25
3,6-Dibenzylpiperazine-2,5-dione REF: TR-D322020CAS: 2308-61-4	- - -	1,151.00 €	Wed 07 May 25
2,5-Piperazinedione REF: 3D-CAA30861CAS: 2308-61-4	Min. 95%	- - -	Discontinued product