CAS 231278-84-5: 5-[4-[[3-chloro-4-[(3-fluorophenyl)methoxy]phenyl]amino]-6-quinazolinyl]-2-Furancarboxaldehyde
Description:The chemical substance known as 5-[4-[[3-chloro-4-[(3-fluorophenyl)methoxy]phenyl]amino]-6-quinazolinyl]-2-furancarboxaldehyde, with the CAS number 231278-84-5, is a complex organic compound characterized by its multi-functional structure. It features a quinazoline core, which is a bicyclic compound known for its biological activity, particularly in medicinal chemistry. The presence of a furancarboxaldehyde moiety suggests potential reactivity due to the aldehyde functional group, which can participate in various chemical reactions, including condensation and nucleophilic addition. The compound also contains a chloro substituent and a fluorophenyl group, which may influence its pharmacological properties and interactions with biological targets. Its intricate structure indicates potential applications in drug development, particularly in targeting specific pathways or receptors in disease processes. The compound's solubility, stability, and reactivity would depend on its specific functional groups and overall molecular conformation, making it a subject of interest for further research in medicinal chemistry and related fields.
Formula:C26H17ClFN3O3
InChI:InChI=1/C26H17ClFN3O3/c27-22-12-19(5-8-25(22)33-14-16-2-1-3-18(28)10-16)31-26-21-11-17(4-7-23(21)29-15-30-26)24-9-6-20(13-32)34-24/h1-13,15H,14H2,(H,29,30,31)
- Synonyms:
- 5-[4-((3-Chloro-4-((3-fluorobenzyl)oxy)phenyl)amino)quinazolin-6-yl]-2-furaldehyde
- [5-[4-[4-[(3-Fluorobenzyl)oxy]-3-chloroanilino]-6-quinazolinyl]-2-furancarboxaldehyde
- 5-[4-({3-Chloro-4-[(3-Fluorobenzyl)Oxy]Phenyl}Amino)Quinazolin-6-Yl]Furan-2-Carbaldehyde
- 5-(4-(3-Chloro-4-((3-fluorobenzyloxy)phenyl)amino)quinazolin-6-yl)furan-2-carbaldehyde
- Lapatinib Intermediate 3
- 5-[4-[[3-chloro-4-[(3-fluorophenyl)methoxy] phenyl]amino]-6-quinazolinyl]-2-Furancarboxaldehyde

2-Furancarboxaldehyde, 5-[4-[[3-chloro-4-[(3-fluorophenyl)methoxy]phenyl]amino]-6-quinazolinyl]-
Ref: IN-DA002M90
1g | 25.00 € | ||
5g | 48.00 € | ||
10g | 57.00 € | ||
25g | 107.00 € | ||
100g | 322.00 € | ||
250mg | 21.00 € |

5-[4-[[3-Chloro-4-[(3-fluorobenzyl)oxy]phenyl]amino]quinazolin-6-yl]furan-2-carboxaldehyde
Ref: 54-PC99876
25g | 173.00 € | ||
100g | 590.00 € |

Lapatinib Impurity 9
Ref: 4Z-L-2510
5mg | To inquire | ||
10mg | To inquire | ||
25mg | To inquire | ||
50mg | To inquire | ||
100mg | To inquire |

5-(4-((3-Chloro-4-((3-fluorobenzyl)oxy)phenyl)amino)quinazolin-6-yl)furan-2-carbaldehyde
Ref: 10-F545007
5g | 21.00 € | ||
10g | 42.00 € | ||
25g | To inquire |

5-(4-((3-Chloro-4-((3-fluorobenzyl)oxy)phenyl)amino) quinazolin-6-yl)furan-2-carbaldehyde
Ref: 3D-FC32843
5g | 219.00 € | ||
10g | 350.00 € | ||
25g | 475.00 € | ||
50g | 730.00 € | ||
100g | 1,048.00 € |

5-[4-[[3-Chloro-4-[(3-fluorophenyl)methoxy]phenyl]amino]-6-quinazolinyl]-2-furancarboxaldehyde
Controlled ProductRef: TR-C366385
5g | 1,004.00 € |