CAS 23147-57-1: 2,3,5,6-Tetramethyl-1,4-dioxane-2,5-diol

Description:2,3,5,6-Tetramethyl-1,4-dioxane-2,5-diol is an organic compound characterized by its dioxane structure, which features a six-membered ring containing two oxygen atoms. This compound is notable for its four methyl groups attached to the carbon atoms in the ring, contributing to its hydrophobic properties and influencing its solubility in various solvents. The presence of hydroxyl (-OH) groups at the 2 and 5 positions enhances its polarity, making it more soluble in polar solvents like water. This compound is typically used in organic synthesis and may serve as an intermediate in the production of other chemical substances. Its molecular structure allows for potential applications in pharmaceuticals and materials science. Safety data indicates that, like many organic compounds, it should be handled with care, as it may pose health risks if ingested or inhaled. Overall, 2,3,5,6-Tetramethyl-1,4-dioxane-2,5-diol is a versatile compound with unique chemical properties that make it valuable in various chemical applications.

Formula:C₈H₁₆O₄

InChI:InChI=1S/C8H16O4/c1-5-7(3,9)12-6(2)8(4,10)11-5/h5-6,9-10H,1-4H3

InChI key:InChIKey=DFMGATPNJMFDCR-UHFFFAOYSA-N

SMILES:OC1(OC(C)C(O)(OC1C)C)C

Synonyms:
1,4-Dioxane-2,5-diol, 2,3,5,6-tetramethyl-
2,3,5,6-Tetramethyl-1,4-dioxane-2,5-diol
2,5-Dihydroxy-2,3,5,6-tetramethyl-1,4-dioxane
p-Dioxane-2,5-diol, 2,3,5,6-tetramethyl-

Found 3 products.

Product data	Purity	Price range	Estimated delivery
Acetoin (May exist as crystalline dimer) REF: 3B-H0225CAS: 23147-57-1 513-86-0	>98.0%(GC)	38.00 €~310.00 €	Thu 20 Mar 25
1,4-Dioxane-2,5-diol, 2,3,5,6-tetramethyl- REF: IN-DA002MDACAS: 23147-57-1	95%	34.00 €~140.00 €	Thu 27 Mar 25
Acetoin, 96%, may exist as mixture of monomer and dimer REF: AC-41195CAS: 23147-57-1	96%	To inquire	Tue 01 Apr 25