CAS 23277-00-1: Phosphonium, (1-naphthalenylmethyl)triphenyl-, chloride (1:1)
Description:Phosphonium, (1-naphthalenylmethyl)triphenyl-, chloride (1:1), commonly referred to as a phosphonium salt, is characterized by its quaternary ammonium structure, where a phosphorus atom is bonded to three phenyl groups and one naphthalenylmethyl group. This compound typically exhibits a white to light yellow crystalline appearance and is soluble in organic solvents such as dichloromethane and acetone, but generally insoluble in water due to its hydrophobic nature. The presence of the chloride ion indicates that it is a salt, which can influence its reactivity and stability. Phosphonium salts are known for their utility in organic synthesis, particularly in the formation of ylides, which are important intermediates in various chemical reactions, including the Wittig reaction. Additionally, the unique structure of this compound may impart specific electronic properties, making it of interest in materials science and catalysis. Safety data should be consulted, as with all chemical substances, to ensure proper handling and usage.
Formula:C29H24P·Cl
InChI:InChI=1S/C29H24P.ClH/c1-4-16-26(17-5-1)30(27-18-6-2-7-19-27,28-20-8-3-9-21-28)23-25-15-12-14-24-13-10-11-22-29(24)25;/h1-22H,23H2;1H/q+1;/p-1
InChI key:InChIKey=MOYSMPXSEXYEJV-UHFFFAOYSA-M
SMILES:[Cl-].C=1C=CC(=CC1)[P+](C=2C=CC=CC2)(C=3C=CC=CC3)CC4=CC=CC=5C=CC=CC54
- Synonyms:
- (1-Naphthalenemethyl)triphenylphosphonium chloride
- (Naphthalen-1-Ylmethyl)(Triphenyl)Phosphonium Chloride
- 1-Naphthylmethyltriphenylphosphonium chloride
- FS 1 (vulcanization accelerator)
- Phosphonium, (1-naphthalenylmethyl)triphenyl-, chloride
- Phosphonium, (1-naphthalenylmethyl)triphenyl-, chloride (1:1)
- Phosphonium, (1-naphthylmethyl)triphenyl-, chloride
- FS 1
