CAS 23279-22-3: L-Tyrosine, 3-amino-, dihydrochloride
Description:L-Tyrosine, 3-amino-, dihydrochloride, with the CAS number 23279-22-3, is a derivative of the amino acid tyrosine, which is a non-essential amino acid important for protein synthesis and the production of neurotransmitters. This compound is characterized by its two hydrochloride groups, which enhance its solubility in water, making it suitable for various biochemical applications. L-Tyrosine plays a crucial role in the synthesis of catecholamines, such as dopamine, norepinephrine, and epinephrine, and is involved in the production of melanin, the pigment responsible for skin and hair color. In terms of physical properties, it typically appears as a white crystalline powder. The dihydrochloride form indicates that it is a salt, which can influence its stability and bioavailability. L-Tyrosine is often used in dietary supplements and is studied for its potential effects on cognitive function, stress response, and mood enhancement. As with any chemical substance, proper handling and storage conditions are essential to maintain its integrity and efficacy.
Formula:C9H12N2O3·2ClH
InChI:InChI=1S/C9H12N2O3.2ClH/c10-6-3-5(1-2-8(6)12)4-7(11)9(13)14;;/h1-3,7,12H,4,10-11H2,(H,13,14);2*1H/t7-;;/m0../s1
InChI key:InChIKey=PIFWBMTWCTUOOQ-KLXURFKVSA-N
SMILES:Cl.O=C(O)C(N)CC1=CC=C(O)C(N)=C1
- Synonyms:
- 3-Amino-<span class="text-smallcaps">L</span>-tyrosine dihydrochloride
- 3-Amino-Tyrosine-2 Hcl
- <span class="text-smallcaps">L</span>-Tyrosine, 3-amino-, dihydrochloride
- H-Tyr(3-NH2)-OH・2HCl
- Tyrosine, 3-amino-, dihydrochloride, <span class="text-smallcaps">L</span>-
- Tyrosine, 3-amino-, dihydrochloride, L-
- L-Tyrosine, 3-amino-, dihydrochloride
- 3-Amino-L-tyrosine dihydrochloride
