CAS 23316-67-8: 2,3,5-Tri-O-benzoyl-beta-D-ribofuranosyl cyanide
Description:2,3,5-Tri-O-benzoyl-beta-D-ribofuranosyl cyanide is a chemical compound that belongs to the class of nucleoside derivatives. It features a ribofuranose sugar moiety that is fully protected with benzoyl groups at the 2', 3', and 5' positions, which enhances its stability and solubility in organic solvents. The presence of the cyanide group introduces a reactive functional group, making it useful in various synthetic applications, particularly in the field of organic chemistry and nucleoside chemistry. This compound is typically utilized in the synthesis of more complex molecules, including nucleotides and nucleic acid analogs. Its structure allows for specific reactivity patterns, making it a valuable intermediate in the development of pharmaceuticals and biochemicals. Additionally, the benzoyl protecting groups can be selectively removed under mild conditions, facilitating further functionalization of the ribofuranose unit. Overall, 2,3,5-Tri-O-benzoyl-beta-D-ribofuranosyl cyanide is an important compound in synthetic organic chemistry, particularly in the context of nucleoside synthesis.
Formula:C27H21NO7
InChI:InChI=1/C27H21NO7/c28-16-21-23(34-26(30)19-12-6-2-7-13-19)24(35-27(31)20-14-8-3-9-15-20)22(33-21)17-32-25(29)18-10-4-1-5-11-18/h1-15,21-24H,17H2/t21-,22+,23-,24+/m0/s1
- Synonyms:
- 4-(Benzoyloxy)-2-[(Benzoyloxy)Methyl]-5-Cyanotetrahydrofuran-3-Yl Benzoate
- 2-[(Benzoyloxy)Methyl]-5-Cyanotetrahydrofuran-3,4-Diyl Dibenzoate (Non-Preferred Name)
- (2S,3S,4R,5R)-2-cyano-5-{[(phenylcarbonyl)oxy]methyl}tetrahydrofuran-3,4-diyl dibenzoate (non-preferred name)
- 2,3,5-Tri-O-benzoyl-β-D-ribofuranosyl cyanide
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | 2,3,5-Tri-O-benzoyl-β-D-ribofuranosyl cyanide REF: 3D-MT06417CAS: 23316-67-8 | Min. 98 Area-% | 151.00 €~1,179.00 € | Mon 07 Apr 25 |

2,3,5-Tri-O-benzoyl-β-D-ribofuranosyl cyanide
Ref: 3D-MT06417
1g | 343.00 € | ||
2g | 550.00 € | ||
5g | 1,179.00 € | ||
250mg | 151.00 € | ||
500mg | 200.00 € |