CAS 2343-22-8: 5-Fluoroindoline

Description:5-Fluoroindoline is a chemical compound characterized by its indoline structure, which consists of a fused benzene and pyrrole ring, with a fluorine atom substituted at the 5-position of the indoline moiety. This substitution can influence the compound's electronic properties, reactivity, and potential biological activity. Typically, 5-Fluoroindoline is a solid at room temperature and may exhibit moderate solubility in organic solvents, depending on its specific structure and functional groups. The presence of the fluorine atom can enhance lipophilicity and alter the compound's interaction with biological targets, making it of interest in medicinal chemistry and drug development. Additionally, 5-Fluoroindoline may participate in various chemical reactions, including nucleophilic substitutions and electrophilic aromatic substitutions, due to the reactivity of the indoline framework. Its unique properties make it a valuable compound for research in organic synthesis and pharmacology. Safety data should be consulted for handling and usage, as with any chemical substance.

Formula:C₈H₈FN

InChI:InChI=1/C8H8FN/c9-7-1-2-8-6(5-7)3-4-10-8/h1-2,5,10H,3-4H2

Synonyms:
5-Fluoro-2,3-dihydro-(1H)-indole
5-Fluoro-2,3-dihydro-indole

Found 5 products.

Product data	Purity	Price range	Estimated delivery
5-Fluoroindoline, 97% REF: 02-H54158CAS: 2343-22-8	97%	To inquire	Fri 21 Mar 25
1H-Indole, 5-fluoro-2,3-dihydro- REF: IN-DA002N7JCAS: 2343-22-8	95%	To inquire	Thu 27 Mar 25
5-Fluoroindoline REF: 54-PC2339CAS: 2343-22-8	96%	80.00 €~1,056.00 €	Fri 28 Mar 25
5-Fluoroindoline REF: 10-F009193CAS: 2343-22-8	97.0%	To inquire	Tue 08 Apr 25
5-Fluoro-2,3-dihydro-(1H)-indole REF: 3D-FF50864CAS: 2343-22-8	Min. 95%	- - -	Discontinued product