CAS 2345-38-2: 2-(Trimethylsilyl)acetic acid

Description:2-(Trimethylsilyl)acetic acid, with the CAS number 2345-38-2, is an organosilicon compound characterized by the presence of a trimethylsilyl group attached to the acetic acid structure. This compound typically appears as a colorless to pale yellow liquid and is known for its relatively low volatility and high stability under standard conditions. The trimethylsilyl group enhances the compound's hydrophobic properties, making it less soluble in water but more soluble in organic solvents. It is often utilized in organic synthesis as a protecting group for carboxylic acids and in various chemical reactions due to its ability to stabilize reactive intermediates. Additionally, 2-(Trimethylsilyl)acetic acid can serve as a reagent in the synthesis of other silicon-containing compounds. Its chemical behavior is influenced by the presence of both the carboxylic acid functional group and the silicon moiety, allowing for unique reactivity patterns in synthetic applications. Safety data should be consulted for handling, as with all chemical substances, to ensure proper precautions are taken.

Formula:C₅H₁₂O₂Si

InChI:InChI=1S/C5H12O2Si/c1-8(2,3)4-5(6)7/h4H2,1-3H3,(H,6,7)

InChI key:InChIKey=JDMMZVAKMAONFU-UHFFFAOYSA-N

SMILES:O=C(O)C[Si](C)(C)C

Synonyms:
(Carboxymethyl)-trimethylsilane
(Trimethylsilyl)acetic acid
Acetic acid, (trimethylsilyl)-
Acetic acid, 2-(trimethylsilyl)-
Trimethylsilylacetic acid

Found 3 products.

Product data	Purity	Price range	Estimated delivery
Acetic acid, 2-(trimethylsilyl)- REF: IN-DA002NA3CAS: 2345-38-2	95%	To inquire	Thu 27 Mar 25
(Trimethylsilyl)acetic acid REF: 3D-CAA34538CAS: 2345-38-2	Min. 95%	To inquire	Thu 08 May 25
(Trimethylsilyl)acetic acid REF: 10-S18925CAS: 2345-38-2	95%	- - -	Discontinued product