CAS 23560-66-9: 2-Methyldibenz[b,e]oxepin-11(6H)-one

Description:2-Methyldibenz[b,e]oxepin-11(6H)-one, with the CAS number 23560-66-9, is a chemical compound that belongs to the class of dibenzoxepins, which are polycyclic aromatic compounds. This substance features a fused ring system that includes both benzene and oxepin structures, contributing to its unique chemical properties. It is characterized by its relatively complex molecular structure, which includes multiple aromatic rings and a ketone functional group. The presence of the methyl group at the 2-position of the dibenzoxepin framework can influence its reactivity and interaction with biological systems. This compound may exhibit interesting pharmacological properties, making it a subject of interest in medicinal chemistry. Its solubility, stability, and reactivity can vary depending on the solvent and environmental conditions. As with many organic compounds, safety and handling precautions should be observed, as it may pose health risks if not managed properly. Further research is often necessary to fully understand its potential applications and effects.

Formula:C₁₅H₁₂O₂

InChI:InChI=1S/C15H12O2/c1-10-6-7-14-13(8-10)15(16)12-5-3-2-4-11(12)9-17-14/h2-8H,9H2,1H3

InChI key:InChIKey=QKBZVICFFSSIDH-UHFFFAOYSA-N

SMILES:O=C1C=2C=CC=CC2COC3=CC=C(C=C31)C