CAS 236406-47-6: tert-butyl 3,9-diazaspiro[5.5]undecane-3-carboxylate hydrochloride

Description:Tert-butyl 3,9-diazaspiro[5.5]undecane-3-carboxylate hydrochloride is a chemical compound characterized by its unique spirocyclic structure, which incorporates both nitrogen atoms and a carboxylate functional group. This compound features a tert-butyl ester group, contributing to its hydrophobic properties and potential solubility in organic solvents. The presence of the diazaspiro framework suggests interesting conformational flexibility and may influence its biological activity, making it a subject of interest in medicinal chemistry. As a hydrochloride salt, it is typically more stable and soluble in aqueous solutions compared to its free base form, which is advantageous for various applications, including drug formulation. The compound's molecular structure may also impart specific interactions with biological targets, potentially leading to pharmacological effects. Overall, tert-butyl 3,9-diazaspiro[5.5]undecane-3-carboxylate hydrochloride represents a complex and intriguing molecule with potential utility in research and therapeutic contexts.

Formula:C₁₄H₂₇ClN₂O₂

InChI:InChI=1S/C14H26N2O2.ClH/c1-13(2,3)18-12(17)16-10-6-14(7-11-16)4-8-15-9-5-14;/h15H,4-11H2,1-3H3;1H

InChI key:InChIKey=SABRTFCGXPHVTA-UHFFFAOYSA-N

SMILES:Cl.O=C(OC(C)(C)C)N1CCC2(CCNCC2)CC1

Found 4 products.

Product data	Purity	Price range	Estimated delivery
tert-Butyl 3,9-diazaspiro[5.5]undecane-3-carboxylate hydrochloride REF: IN-DA002O0JCAS: 236406-47-6	95%	24.00 €~474.00 €	Thu 27 Mar 25
tert-Butyl 3,9-diazaspiro[5.5]undecane-3-carboxylate hydrochloride REF: 54-OR73592CAS: 236406-47-6	95%	85.00 €~1,282.00 €	Fri 28 Mar 25
Tert-Butyl 3,9-diazaspiro[5.5]undecane-3-carboxylate hydrochloride REF: 10-F232416CAS: 236406-47-6	95.0%	To inquire	Tue 08 Apr 25
tert-Butyl 3,9-diazaspiro[5.5]undecane-3-carboxylate hydrochloride REF: 3D-LJA40647CAS: 236406-47-6	Min. 95%	To inquire	Thu 08 May 25