CAS 24010-80-8: 1-cyano-2-ethylguanidine

Description:1-Cyano-2-ethylguanidine is an organic compound characterized by its guanidine structure, which features a cyano group (-CN) and an ethyl group (-C2H5) attached to the nitrogen atoms. This compound is typically a white to off-white solid and is soluble in polar solvents, reflecting its polar functional groups. It exhibits basic properties due to the presence of guanidine, which can participate in proton transfer reactions. The cyano group contributes to its reactivity, allowing it to engage in nucleophilic reactions and serve as a building block in organic synthesis. 1-Cyano-2-ethylguanidine is of interest in various fields, including medicinal chemistry and materials science, due to its potential applications in drug development and as a precursor for other chemical compounds. Safety data indicates that, like many organic compounds, it should be handled with care, as it may pose health risks if ingested or inhaled. Proper laboratory safety protocols should be followed when working with this substance.

Formula:C₄H₈N₄

InChI:InChI=1/C4H8N4/c1-2-7-4(6)8-3-5/h2H2,1H3,(H3,6,7,8)

Found 2 products.

Brand	Product data	Purity	Price range	Estimated delivery
	1-cyano-3-ethylguanidine REF: 10-F510659CAS: 24010-80-8	- - -	- - -	Discontinued product
	1-Cyano-2-ethylguanidine REF: 3D-ZAA01080CAS: 24010-80-8	Min. 95%	- - -	Discontinued product