CAS 24078-21-5: Benzoic acid, 3-methyl-4-nitro-, methyl ester
Description:Benzoic acid, 3-methyl-4-nitro-, methyl ester, with the CAS number 24078-21-5, is an organic compound characterized by its ester functional group, which is derived from benzoic acid. This compound features a methyl group and a nitro group positioned on the benzene ring, specifically at the 3 and 4 positions, respectively. The presence of the nitro group contributes to its potential reactivity and polar nature, while the methyl ester group enhances its solubility in organic solvents. Typically, this compound appears as a solid or liquid, depending on the temperature, and may exhibit a distinct aromatic odor. It is often used in organic synthesis and may serve as an intermediate in the production of various pharmaceuticals and agrochemicals. As with many nitro compounds, it may pose certain health and environmental risks, necessitating careful handling and storage. Its chemical properties, such as melting point, boiling point, and solubility, can vary based on purity and environmental conditions.
Formula:C9H9NO4
InChI:InChI=1S/C9H9NO4/c1-6-5-7(9(11)14-2)3-4-8(6)10(12)13/h3-5H,1-2H3
InChI key:InChIKey=IEFONJKJLZFGKQ-UHFFFAOYSA-N
SMILES:O=C(OC)C1=CC=C(C(=C1)C)N(=O)=O
- Synonyms:
- 3-Methyl-4-Nitrobenzoic Acid Methyl Ester
- Benzoic acid, 3-methyl-4-nitro-, methyl ester
- Buttpark 62\04-20
- Methyl 4-Methyl-3-Nitrobenzoate
- Methyl 4-Nitro-3-Methyl benzoate
- N-PROPYL-4-METHYL-6-CARBOXY-BENZIMIDAZOLE；4-Nitro-m-toluic acid methyl ester
- NSC 92763
- m-Toluic acid, 4-nitro-, methyl ester
- Methyl 3-methyl-4-nitrobenzoate
