CAS 24088-69-5: (3,4-dichlorophenyl)-[2-(morpholinomethyl)phenyl]methanone
Description:(3,4-Dichlorophenyl)-[2-(morpholinomethyl)phenyl]methanone, with CAS number 24088-69-5, is a synthetic organic compound characterized by its complex structure, which includes a dichlorophenyl group and a morpholinomethyl substituent. This compound typically exhibits properties associated with both aromatic and heterocyclic systems, contributing to its potential biological activity. The presence of the dichlorophenyl moiety suggests that it may possess significant lipophilicity, which can influence its solubility and permeability in biological systems. The morpholine ring adds to its pharmacological profile, potentially enhancing interactions with biological targets. Such compounds are often investigated for their potential applications in medicinal chemistry, particularly in the development of pharmaceuticals. The specific functional groups present in this molecule may also impart unique reactivity and stability characteristics, making it of interest in various chemical reactions and applications. Overall, this compound exemplifies the complexity and diversity of synthetic organic molecules used in research and development.
Formula:C18H17Cl2NO2
InChI:InChI=1/C18H17Cl2NO2/c19-16-6-5-13(11-17(16)20)18(22)15-4-2-1-3-14(15)12-21-7-9-23-10-8-21/h1-6,11H,7-10,12H2
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | 3',4'-Dichloro-2-morpholinomethyl benzophenone REF: 10-F205152CAS: 24088-69-5 | 97.0% | To inquire | Tue 08 Apr 25 |
![]() | 3',4'-Dichloro-2-morpholinomethyl benzophenone REF: 3D-ZAA08869CAS: 24088-69-5 | Min. 95% | - - - | Discontinued product |

3',4'-Dichloro-2-morpholinomethyl benzophenone
Ref: 3D-ZAA08869
5g | Discontinued | Request information |