CAS 24160-53-0: 3-(2,4,5-Trimethoxyphenyl)-2-propenoic acid
Description:3-(2,4,5-Trimethoxyphenyl)-2-propenoic acid, also known by its CAS number 24160-53-0, is an organic compound characterized by its propenoic acid structure, which features a double bond between the second and third carbon atoms of the propene chain. The presence of a 2,4,5-trimethoxyphenyl group indicates that the compound has three methoxy (-OCH3) substituents on a phenyl ring, contributing to its unique chemical properties and potential biological activity. This compound is likely to exhibit moderate solubility in organic solvents due to its hydrophobic methoxy groups, while its carboxylic acid functional group (-COOH) can impart some degree of polarity, allowing for interactions with polar solvents. The methoxy groups can also influence the compound's reactivity and stability, potentially affecting its behavior in various chemical reactions. Additionally, compounds with similar structures have been studied for their potential applications in pharmaceuticals and as intermediates in organic synthesis, although specific biological activities would require further investigation.
Formula:C12H14O5
InChI:InChI=1S/C12H14O5/c1-15-9-7-11(17-3)10(16-2)6-8(9)4-5-12(13)14/h4-7H,1-3H3,(H,13,14)
InChI key:InChIKey=XCEGAEUDHJEYRY-UHFFFAOYSA-N
SMILES:O=C(O)C=CC1=CC(OC)=C(OC)C=C1OC
- Synonyms:
- (2E)-3-(2,4,5-trimethoxyphenyl)prop-2-enoate
- (2E)-3-(2,4,5-trimethoxyphenyl)prop-2-enoic acid
- 2,4,5-Trimethoxycinnamic acid
- 2-Propenoic acid, 3-(2,4,5-trimethoxyphenyl)-
- 3-(2,4,5-Trimethoxyphenyl)-2-propenoic acid
- 3-(2,4,5-Trimethoxyphenyl)Prop-2-Enoic Acid
- Cinnamic acid, 2,4,5-trimethoxy-
- NSC 89300
