CAS 24167-44-0: 10-bromo-10,11-dihydro-5H-dibenzo[a,d][7]annulen-5-one
Description:10-bromo-10,11-dihydro-5H-dibenzo[a,d][7]annulen-5-one is an organic compound characterized by its complex polycyclic structure, which includes fused aromatic rings. The presence of a bromine atom at the 10-position contributes to its reactivity and potential applications in organic synthesis and materials science. This compound features a ketone functional group, which can participate in various chemical reactions, such as nucleophilic additions. The dihydro form indicates that it has two hydrogen atoms added to the structure, affecting its stability and reactivity compared to fully aromatic compounds. Its unique structure may impart interesting electronic and optical properties, making it a candidate for research in fields like organic electronics or photochemistry. Additionally, the compound's CAS number, 24167-44-0, allows for easy identification and retrieval of information in chemical databases. Overall, 10-bromo-10,11-dihydro-5H-dibenzo[a,d][7]annulen-5-one is a notable compound in the realm of organic chemistry, with potential implications in various scientific applications.
Formula:C15H11BrO
InChI:InChI=1/C15H11BrO/c16-14-9-10-5-1-2-6-11(10)15(17)13-8-4-3-7-12(13)14/h1-8,14H,9H2
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | Cyclobenzaprine Impurity 4 REF: 4Z-C-3117CAS: 24167-44-0 | - - - | To inquire | Thu 03 Apr 25 |

Ref: 4Z-C-3117
5mg | To inquire | ||
10mg | To inquire | ||
25mg | To inquire | ||
50mg | To inquire | ||
100mg | To inquire |