CAS 24198-97-8: rel-(2R,3R)-2-(3,4-Dihydroxyphenyl)-2,3-dihydro-3,5,7-trihydroxy-4H-1-benzopyran-4-one
Description:The chemical substance known as rel-(2R,3R)-2-(3,4-Dihydroxyphenyl)-2,3-dihydro-3,5,7-trihydroxy-4H-1-benzopyran-4-one, with the CAS number 24198-97-8, is a flavonoid compound characterized by its complex polyphenolic structure. This compound features multiple hydroxyl groups, which contribute to its potential antioxidant properties, making it of interest in various biological and pharmacological studies. The presence of the benzopyran moiety indicates that it belongs to the flavonoid class, which is known for its diverse biological activities, including anti-inflammatory, anti-cancer, and neuroprotective effects. The stereochemistry of the molecule, indicated by the rel-(2R,3R) configuration, suggests specific spatial arrangements that can influence its biological interactions and efficacy. Additionally, the dihydroxyphenyl group enhances its reactivity and potential interactions with biological targets. Overall, this compound's unique structure and functional groups position it as a candidate for further research in medicinal chemistry and natural product studies.
Formula:C15H12O7
InChI:InChI=1/C15H12O7/c16-7-4-10(19)12-11(5-7)22-15(14(21)13(12)20)6-1-2-8(17)9(18)3-6/h1-5,14-19,21H/t14-,15+/s2
InChI key:InChIKey=CXQWRCVTCMQVQX-PVRQQBJHNA-N
SMILES:O=C1C=2C(O)=CC(O)=CC2OC(C3=CC=C(O)C(O)=C3)C1O
- Synonyms:
- (?à)-Dihydroquercetin
- (?à)-Taxifolin
- (±)-Dihydroquercetin
- (±)-Taxifolin
- 4H-1-Benzopyran-4-one, 2-(3,4-dihydroxyphenyl)-2,3-dihydro-3,5,7-trihydroxy-, trans-(±)-
- 4H-1-Benzopyran-4-one,2-(3,4-dihydroxyphenyl)-2,3-dihydro-3,5,7-trihydroxy-, trans-(?à)- (8CI)
- rel-(2R,3R)-2-(3,4-Dihydroxyphenyl)-2,3-dihydro-3,5,7-trihydroxy-4H-1-benzopyran-4-one
- 4H-1-Benzopyran-4-one, 2-(3,4-dihydroxyphenyl)-2,3-dihydro-3,5,7-trihydroxy-, (2R,3R)-rel-
